
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 158563-45-2 |
| Catalog No. | 2A-9093082 |
| Chinese Name | 九肽-1 |
| Synonyms | Nonapeptide-1; Melitane; H-Met-Pro-D-Phe-Arg-D-Trp-Phe-Lys-Pro-Val-NH2; Melanostatine |
| Molecular Formula | C61H87O9N15S1 |
| Molecular Weight | 1206.52 |
| Density | 1.4±0.1 g/cm3 |
| Storage Condition | Room temperature, dry and sealed |
| Application | Nonapeptide-1 (melanostatin-5) is a peptide hormone and a selective antagonist of MC1R (Ki: 40nM). Nonapeptide-1 is a competitive α-MSH antagonist that can effectively inhibit α-MSH-induced intracellu |
| PubChem ID | 15436525 |
| MDL Number | MFCD00672435 |
| SMILES | CSCCC(N)C(=O)N1CCCC1C(=O)NC(Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCCN)C(=O)N1CCCC1C(=O)NC(C(N)=O)C(C)C |
| InChI | InChI=1S/C61H87N15O9S/c1-37(2)51(52(64)77)74-58(83)50-26-16-31-76(50)60(85)45(23-12-13-28-62)70-55(80)46(33-38-17-6-4-7-18-38)71-56(81)48(35-40-36-68-43-22-11-10-21-41(40)43)72-53(78)44(24-14-29-67-61(65)66)69-54(79)47(34-39-19-8-5-9-20-39)73-57(82)49-25-15-30-75(49)59(84)42(63)27-32-86-3/h4-11,17-22,36-37,42,44-51,68H,12-16,23-35,62-63H2,1-3H3,(H2,64,77)(H,69,79)(H,70,80)(H,71,81)(H,72,78)(H,73,82)(H,74,83)(H4,65,66,67)/t42-,44-,45-,46-,47+,48+,49-,50-,51-/m0/s1 |
| InChI Key | KNFLNGRLKALWRF-LDXSYGEZSA-N |
| MSDS | msds/93082_1_158563_45_2.pdf |
| Transport Info | Product Name: Nonapeptide-1 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| DB 40% Propylene Glycol Water | 2A-174736 | 2A-9093069 |
| DB 4% in Water Solution | 2A-174738 | 2A-9093071 |
| Glycine, N-(1-oxohexadecyl)-L-valylglycyl-L-valyl-L-alanyl-L-prolyl- | 171263-26-6 | 2A-9093079 |
| PALMITOYL TETRAPEPTIDE 3 | 221227-05-0 | 2A-9093080 |
| L-Lysine, N-(1-oxohexadecyl)glycyl-L-histidyl- | 147732-56-7 | 2A-9093081 |
| TYR-D-ALA-GLY-PHE-LEU | 64963-01-5 | 2A-9093083 |
| Glycyl-L-prolyl-L-arginyl-L-prolyl-L-alaninamide | 135679-88-8 | 2A-9093084 |
| H-Ala-His-Lys-OH | 126828-32-8 | 2A-9093085 |
| Pentafluoro(3-hydroxy-1-propenyl)sulfur | 155990-90-2 | 2A-9093086 |
| Rutamarin | 14882-94-1 | 2A-9093087 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA