
CAS Number1187-00-4
SynonymsO1,O6-Dimethansulfonyl-D-mannit; Mannogranol; D-Mannitol busulphan; D-Mannitol busulfan; O1,O6-bis-methanesulfonyl-D-mannitol; 1,6-Bis-methansulfonyl-D-mannit; MANNITOL,1,6-DIMETHYLSULPHONATE,D; 1,6-Di-O-methansulfonyl-D-mannitol; O1,O6-Bis-methansulfonyl-D-mannit; 1,6-Dimethanesulfonate-D-mannitol; 1,6-Bis-methansulfonyloxy-D-manno-hexan-2,3,4,5-tetraol; 1,6-Dimesyl-D-mannitol; 1,6-Di-O-methansulfonyl-D-mannit; 1,6-Dimethanesulfonoxy-D-mannitol
Molecular FormulaC47H40O14S2
Molecular Weight892.962
Purity96%%
Density1.635g/cm3
Boiling Point721.3ºC at 760 mmHg
Melting Point134-136 °C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1187-00-4 |
| Catalog No. | 2A-9093048 |
| Chinese Name | 甘露醇二磺酸酯 |
| Synonyms | O1,O6-Dimethansulfonyl-D-mannit; Mannogranol; D-Mannitol busulphan; D-Mannitol busulfan; O1,O6-bis-methanesulfonyl-D-mannitol; 1,6-Bis-methansulfonyl-D-mannit; MANNITOL,1,6-DIMETHYLSULPHONATE,D; 1,6-Di-O-methansulfonyl-D-mannitol; O1,O6-Bis-methansulfonyl-D-mannit; 1,6-Dimethanesulfonate-D-mannitol; 1,6-Bis-methansulfonyloxy-D-manno-hexan-2,3,4,5-tetraol; 1,6-Dimesyl-D-mannitol; 1,6-Di-O-methansulfonyl-D-mannit; 1,6-Dimethanesulfonoxy-D-mannitol |
| Molecular Formula | C47H40O14S2 |
| Molecular Weight | 892.962 |
| Purity | 96% |
| Density | 1.635g/cm3 |
| Boiling Point | 721.3ºC at 760 mmHg |
| Melting Point | 134-136 °C |
| Storage Condition | 1. The warehouse is ventilated and dried at low te |
| HTC | 2905499000 |
| PubChem ID | 10248137 |
| MDL Number | MFCD02685308 |
| SMILES | CS(=O)(=O)OCC(O)C(O)C(O)C(O)COS(C)(=O)=O |
| InChI | InChI=1S/C8H18O10S2/c1-19(13,14)17-3-5(9)7(11)8(12)6(10)4-18-20(2,15)16/h5-12H,3-4H2,1-2H3 |
| InChI Key | ODOISJJCWUVNDJ-WCTZXXKLSA-N |
| MSDS | msds/93048_1_1187_00_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2905499000 other polyhydric alcohols. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Deloxolone | 68635-50-7 | 2A-9093042 |
| 4-chloro-1,3-dioxan-2-one | 2463-45-8 | 2A-9093043 |
| CHORISMIC ACID | 617-12-9 | 2A-9093045 |
| dolichol monophosphate | 12698-55-4 | 2A-9093046 |
| CHARANTIN(NEW)(P) | 57126-62-2 | 2A-9093047 |
| 2-methyl-2-methylsulfonyloxy-propane | 16427-41-1 | 2A-9093049 |
| TRIFLUOPERAZINE DIMALEATE | 605-75-4 | 2A-9093050 |
| 5-APDI (hydrochloride) | 152623-95-5 | 2A-9093051 |
| pluronicf38 | 106392-12-5 | 2A-9093052 |
| BK-MDA | 80535-73-5 | 2A-9093053 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA