
CAS Number57582-46-4
SynonymsCinnamyl3-oxobutanoate; (2E)-3-Phenylprop-2-en-1-yl 3-oxobutanoate; cinnamyl acetoacetate; (2E)-3-Phenyl-2-propen-1-yl 3-oxobutanoate; Cinnamyl 3-oxobutanoate; Butanoic acid, 3-oxo-, (2E)-3-phenyl-2-propen-1-yl ester; Diacetic Acid Styracine
Molecular FormulaC13H14O3
Molecular Weight218.249
Purity96%%
Density1.1±0.1 g/cm3
Boiling Point358.1±30.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 57582-46-4 |
| Catalog No. | 2A-9093024 |
| Chinese Name | 乙酰乙酸肉桂酯 |
| Synonyms | Cinnamyl3-oxobutanoate; (2E)-3-Phenylprop-2-en-1-yl 3-oxobutanoate; cinnamyl acetoacetate; (2E)-3-Phenyl-2-propen-1-yl 3-oxobutanoate; Cinnamyl 3-oxobutanoate; Butanoic acid, 3-oxo-, (2E)-3-phenyl-2-propen-1-yl ester; Diacetic Acid Styracine |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.249 |
| Purity | 96% |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 358.1±30.0 °C at 760 mmHg |
| HTC | 2918300090 |
| PubChem ID | 127498160 |
| SMILES | CC(=O)CC(=O)OCC=Cc1ccccc1 |
| InChI | InChI=1S/C13H14O3/c1-11(14)10-13(15)16-9-5-8-12-6-3-2-4-7-12/h2-8H,9-10H2,1H3/b8-5- |
| InChI Key | BDCAQAAKRKWXFW-YVMONPNESA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| ANISE OIL | 68952-43-2 | 2A-9093015 |
| ALUMINUM POTASSIUM SULFATE | 10043-67-1 | 2A-9093016 |
| TRIALLYLBORANE | 688-61-9 | 2A-9093017 |
| 4F-PV8 | 99799-28-8 | 2A-9093020 |
| prolintane hydrochloride | 1211-28-5 | 2A-9093022 |
| CALCIUM SULFATE | 99400-01-8 | 2A-9093025 |
| CYANOACRYLIC ACID METHYL ESTER | 137-05-3 | 2A-9093027 |
| ETHYL 4-METHYLOCTANOATE | 56196-53-3 | 2A-9093028 |
| Ceftobiprole | 209467-52-7 | 2A-9093029 |
| GRISEIN | 1391-82-8 | 2A-9093030 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA