
CAS Number17097-90-4
Synonymsmonoester ethylique de l'acide phenyl-2 propane-1,3 dioique; 3-ethoxy-3-oxo-2-phenyl-propionic acid; monoethyl phenylmalonate; 2-phenyl-malonic acid monoethyl ester; phenylmalonic acid monoethyl ester; ethyl hydrogen phenylmalonate; Phenyl-malonsaeure-monoaethylester
Molecular FormulaC11H12O4
Molecular Weight208.21
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17097-90-4 |
| Catalog No. | 2A-9092725 |
| Chinese Name | 2-苯基-缩苹果酸单乙基酯 |
| Synonyms | monoester ethylique de l'acide phenyl-2 propane-1,3 dioique; 3-ethoxy-3-oxo-2-phenyl-propionic acid; monoethyl phenylmalonate; 2-phenyl-malonic acid monoethyl ester; phenylmalonic acid monoethyl ester; ethyl hydrogen phenylmalonate; Phenyl-malonsaeure-monoaethylester |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 |
| HTC | 2918990090 |
| PubChem ID | 3147899 |
| MDL Number | MFCD00091621 |
| SMILES | CCOC(=O)C(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C11H12O4/c1-2-15-11(14)9(10(12)13)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,12,13) |
| InChI Key | INQWZSLKTMTMSK-UHFFFAOYSA-N |
| MSDS | msds/92725_1_17097_90_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Acetyl incensole | 34701-53-6 | 2A-9092710 |
| 3α-acetyloxylanosta-8,24-dien-21-oic acid | 174391-64-1 | 2A-9092712 |
| TRIETHYLTIN | 997-50-2 | 2A-9092716 |
| Bepotastine Besilate | 190786-44-8 | 2A-9092717 |
| 3-Morpholin-4-yl-1-[4-(2-oxopiperidin-1-yl)phenyl]-5,6-dihydro-1H-pyridin-2-one | 545445-44-1 | 2A-9092721 |
| 1-(2-isopropylthiazol-4-yl-N-MethylMethanaMine | 1185167-55-8 | 2A-9092726 |
| 5-bromo-2-nitro-N-phenyl-aniline | 6311-47-3 | 2A-9092728 |
| Apremilast | 608141-41-9 | 2A-9092730 |
| BAZEDOXIFENE ACETATE | 198481-33-3 | 2A-9092731 |
| CB82652832 | 1032900-25-6 | 2A-9092733 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA