
CAS Number880-52-4
SynonymsN-Adamantan-1-ylacetamide; EINECS 212-914-9; 1-Acetamidotricyclo[3.3.1.1(3,7)]decane; N-(1-adamantyl)acetamide; MFCD00074730; 1-acetamidoadamantane; N-(Adamantan-1-yl)acetamide
Molecular FormulaC12H19NO
Molecular Weight193.29
Purity98%
Density1.1±0.1 g/cm3
Boiling Point354.0±9.0 °C at 760 mmHg
Melting Point148-149 °C (lit.)
AppearanceWhite to light yellow crystal powder
EINECS212-914-9
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 880-52-4 |
| Catalog No. | 2A-9000924 |
| Chinese Name | 1-乙酰氨基金刚烷 |
| Synonyms | N-Adamantan-1-ylacetamide; EINECS 212-914-9; 1-Acetamidotricyclo[3.3.1.1(3,7)]decane; N-(1-adamantyl)acetamide; MFCD00074730; 1-acetamidoadamantane; N-(Adamantan-1-yl)acetamide |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 |
| Purity | 98 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 354.0±9.0 °C at 760 mmHg |
| Melting Point | 148-149 °C (lit.) |
| Appearance | White to light yellow crystal powder |
| Storage Condition | Keep container sealed and stored in a cool, dry pl |
| EINECS | 212-914-9 |
| HTC | 2924299090 |
| PubChem ID | 329748970 |
| MDL Number | MFCD00074730 |
| SMILES | CC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | 1S/C12H19NO/c1-8(14)13-12-5-9-2-10(6-12)4-11(3-9)7-12/h9-11H,2-7H2,1H3,(H,13,14) |
| InChI Key | BCVXYGJCDZPKGV-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| Hazard Symbols | Xi |
| Risk Codes | R36/37/38 |
| Safety Description | S24/25 |
| MSDS | msds/924_1_880_52_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 19-Bromononadecanoic acid | 78774-38-6 | 2A-9000914 |
| 19-Hydroxyandrostendione | 510-64-5 | 2A-9000915 |
| 19-Nor-4-androstenedione | 734-32-7 | 2A-9000916 |
| 1-Acetyl-2-imidazolidinone | 5391-39-9 | 2A-9000918 |
| 1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate | 3030-06-6 | 2A-9000923 |
| 1-Adamantanamine | 768-94-5 | 2A-9000926 |
| 1-Adamantanol | 768-95-6 | 2A-9000931 |
| 1-Adamantylmethylketone | 1660-04-4 | 2A-9000933 |
| 1-Amino-1-cyclopentanecarboxamide | 17193-28-1 | 2A-9000935 |
| 1-Amino-3,3-dimethylbutan-2-one | 82962-91-2 | 2A-9000936 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA