
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 20962-71-4 |
| Catalog No. | 2A-9092085 |
| Chinese Name | 2-Acetyl-4-methyl-4-pentenoic acid methyl ester |
| Synonyms | Methyl 2-acetyl-4-methyl-4-pentenoate; 4-Pentenoic acid,2-acetyl-4-methyl-,methyl ester; 2-Acetyl-4-methyl-4-pentenoic acid methyl ester |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.20600 |
| Purity | 98 |
| HTC | 2918300090 |
| PubChem ID | 39361846 |
| SMILES | C=C(C)CC(C(C)=O)C(=O)OC |
| InChI | InChI=1S/C9H14O3/c1-6(2)5-8(7(3)10)9(11)12-4/h8H,1,5H2,2-4H3 |
| InChI Key | WGZVWUIUYMGPKD-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Largazole | 1009815-87-5 | 2A-9092079 |
| Eribulin Mesylate | 441045-17-6 | 2A-9092080 |
| TI6 AL4 V ALLOY | 12743-70-3 | 2A-9092081 |
| ZIRCONIUM DIBORIDE | 12046-91-2 | 2A-9092082 |
| N-DESMETHYL ZOPICLONE | 59878-63-6 | 2A-9092084 |
| etamiphyllin | 314-35-2 | 2A-9092086 |
| C31H53N3O49S8 | 104993-28-4 | 2A-9092087 |
| ICI 164384 | 98007-99-9 | 2A-9092088 |
| Methyl methylsulfonylacetate | 62020-09-1 | 2A-9092091 |
| methyltetrahydrophtalic anhydride | 2A-173779 | 2A-9092095 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA