
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 124689-65-2 |
| Catalog No. | 2A-9092050 |
| Chinese Name | Cryptophycin 1 |
| Synonyms | In Vivo Cryptophycin 1 (i.v.) exhibits anti-tumor activity in mice[3].; References |
| Molecular Formula | C35H43ClN2O8 |
| Molecular Weight | 655.17800 |
| Purity | 95 |
| Density | 1.171g/cm3 |
| Boiling Point | 889.4ºC at 760 mmHg |
| Packaging | III |
| Application | Cryptophycin 1 is a potent cytotoxic antimicrotubule agent isolated from Nostoc sp. Cryptophycin 1 can induce apoptosis and has anti-tumor activity and excellent anti-proliferative capabilities. |
| PubChem ID | 11968060 |
| SMILES | COc1ccc(CC2NC(=O)C=CCC(C(C)C3OC3c3ccccc3)OC(=O)C(CC(C)C)OC(=O)C(C)CNC2=O)cc1Cl |
| InChI | InChI=1S/C35H43ClN2O8/c1-20(2)16-29-35(42)44-27(22(4)31-32(46-31)24-10-7-6-8-11-24)12-9-13-30(39)38-26(33(40)37-19-21(3)34(41)45-29)18-23-14-15-28(43-5)25(36)17-23/h6-11,13-15,17,20-22,26-27,29,31-32H,12,16,18-19H2,1-5H3,(H,37,40)(H,38,39)/b13-9+/t21-,22+,26-,27+,29+,31-,32-/m1/s1 |
| InChI Key | PSNOPSMXOBPNNV-VVCTWANISA-N |
| Hazard Symbols | 6.1(b) |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-KETOGLUCONIC ACID CALCIUM SALT | 28098-92-2 | 2A-9092039 |
| Butanoic acid, 3-chloro-2-oxo-, ethyl ester | 50774-86-2 | 2A-9092042 |
| Ethyl 3-chloro-2-oxobutanoate | 2A-173728 | 2A-9092043 |
| Halcinonide | 3039-35-4 | 2A-9092048 |
| 21-CROWN-7 | 33089-36-0 | 2A-9092049 |
| 6-CHLORO-1,4-DIHYDRO-1-METHYL-4-PHENYL QUINAZOLIN-4-OL | 2A-173736 | 2A-9092051 |
| (4-{[2-(dimethylamino)ethyl]amino}phenyl)methanamine | 951905-26-3 | 2A-9092052 |
| 2-(4-aminophenoxy)ethyl hydrogen sulphate | 40184-38-1 | 2A-9092054 |
| LANTHANUM CARBONATE | 587-26-8 | 2A-9092055 |
| CMX 001 | 444805-28-1 | 2A-9092059 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA