
CAS Number71-73-8
Synonymstrapanal; intravalsodium; 5-ethyl-5-(1-methyl-butyl)-6-oxo-2-thioxo-1,2,5,6-tetrahydro-pyrimidin-4-olate sodium salt; 5-ethyl-5-(1-methylbutyl)-2-thiobarbituric acid sodium salt; leopental; 5-ethyl-5-(1-methylbutyl)-2-thiobarbiturate acid sodium salt; farmotal; Thiopentemal; hypnostan; (±)-THIOPENTAL SODIUM SALT/SODIUM CARBONATE; thiothalsodium; rac-thiopentone sodium; ravonal; thionembutal; nesdonal sodium
Molecular FormulaC11H17N2NaO2S
Molecular Weight264.32000
Purity98%
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 71-73-8 |
| Catalog No. | 2A-9091704 |
| Chinese Name | 硫喷妥钠 |
| Synonyms | trapanal; intravalsodium; 5-ethyl-5-(1-methyl-butyl)-6-oxo-2-thioxo-1,2,5,6-tetrahydro-pyrimidin-4-olate sodium salt; 5-ethyl-5-(1-methylbutyl)-2-thiobarbituric acid sodium salt; leopental; 5-ethyl-5-(1-methylbutyl)-2-thiobarbiturate acid sodium salt; farmotal; Thiopentemal; hypnostan; (±)-THIOPENTAL SODIUM SALT/SODIUM CARBONATE; thiothalsodium; rac-thiopentone sodium; ravonal; thionembutal; nesdonal sodium |
| Molecular Formula | C11H17N2NaO2S |
| Molecular Weight | 264.32000 |
| Purity | 98 |
| Water Solubility | H2O: >10 mg/mL |
| Storage Condition | This product is sealed in an ampoule and stored in |
| Packaging | III |
| HTC | 2933599090 |
| PubChem ID | 7847779 |
| SMILES | CCCC(C)C1(CC)C(=O)NC(=S)NC1=O.[Na+] |
| InChI | InChI=1S/C11H18N2O2S.Na/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15;/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16);/q;+1/p-1 |
| InChI Key | AWLILQARPMWUHA-UHFFFAOYSA-N |
| Hazard Symbols | 6.1(b) |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| LAVENDER OIL | 97660-01-0 | 2A-9091694 |
| Lemon eucalyptus oil | 2A-473384 | 2A-9091695 |
| (-)-2-BETA-CARBOMETHOXY-3-BETA-(4-FLUOROPHENYL)TROPANE | 50370-56-4 | 2A-9091700 |
| 1,4,7,10-TETRAAZA-2,6-PYRIDINOPHANE | 78668-34-5 | 2A-9091702 |
| Exatecan | 171335-80-1 | 2A-9091703 |
| Dichlorotetrafluorobenzene | 2A-473394 | 2A-9091705 |
| M-CRESOL PURPLE, SODIUM SALT | 62625-31-4 | 2A-9091706 |
| BIS(3,5,5-TRIMETHYLHEXYL) PHTHALATE | 20548-62-3 | 2A-9091708 |
| (2S)-1-(Dimethylamino)-2-methyl-3-pentanon | 159144-11-3 | 2A-9091709 |
| 17β-Dihydro Equilenin 3-Sulfate Sodium Salt | 16680-50-5 | 2A-9091711 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA