
CAS Number2635-84-9
Synonymsp-Nitrophenol butyrate; (4-nitrophenyl) butanoate; p-Nitrophenyl butyrate Butyric acid 4-nitrophenyl ester; p-nitrophenyl butyrate; Butyric acid, p-nitrophenyl ester; Butanoic acid, 4-nitrophenyl ester; 4-Nitrophenyl butyrate; MFCD00047734
Molecular FormulaC10H11NO4
Molecular Weight209.20
Purity≥98%
Density1.2±0.1 g/cm3
Boiling Point323.2±25.0 °C at 760 mmHg
Appearanceliquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2635-84-9 |
| Catalog No. | 2A-9091592 |
| Chinese Name | 4-硝基苯丁酸酯 |
| Synonyms | p-Nitrophenol butyrate; (4-nitrophenyl) butanoate; p-Nitrophenyl butyrate Butyric acid 4-nitrophenyl ester; p-nitrophenyl butyrate; Butyric acid, p-nitrophenyl ester; Butanoic acid, 4-nitrophenyl ester; 4-Nitrophenyl butyrate; MFCD00047734 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 |
| Purity | ≥98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 323.2±25.0 °C at 760 mmHg |
| Appearance | liquid |
| Storage Condition | Sealed in a cool, dry environment at 2-8ºC. |
| Application | 4-Nitrophenyl butyrate is a biochemical reagent that can be used as a biological material or organic compound for life science-related research. |
| PubChem ID | 24897915 |
| MDL Number | MFCD00047734 |
| SMILES | CCCC(=O)Oc1ccc(cc1)[N+]([O-])=O |
| InChI | 1S/C10H11NO4/c1-2-3-10(12)15-9-6-4-8(5-7-9)11(13)14/h4-7H,2-3H2,1H3 |
| InChI Key | DVDUMIQZEUTAGK-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1879729 |
| NACRES Code | NA.83 |
| UNSPSC | 12352204 |
| MSDS | msds/91592_1_2635_84_9.pdf |
| Transport Info | Product Name: 4-Nitrophenylbutyrate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Crotonyl glycine | 71428-89-2 | 2A-9091583 |
| 4,5-epiminophenanthrene | 203-65-6 | 2A-9091586 |
| (25R)-5ALPHA-SPIROSTAN-2ALPHA,3BETA-DIOL | 511-96-6 | 2A-9091589 |
| Desfuroyl Ceftiofur Cysteine Disulfide | 158039-15-7 | 2A-9091590 |
| Normal Donkey Serum | 2A-173280 | 2A-9091591 |
| ACH | 2260-50-6 | 2A-9091593 |
| 2-HYDROXYHIPPURIC ACID | 487-54-7 | 2A-9091594 |
| CHROMIC NITRATE NONAHYDRATE | 13548-38-4 | 2A-9091598 |
| bullatacin | 102989-24-2 | 2A-9091599 |
| ubiquitin cross-reactive protein | 60267-61-0 | 2A-9091600 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA