
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 70086-62-3 |
| Catalog No. | 2A-9091545 |
| Chinese Name | 1,1,5,5-四氟-2,4-戊二酮 |
| Synonyms | 1,1,5,5-tetrafluoro-pentane-2,4-dione |
| Molecular Formula | C5H4O2F4 |
| Molecular Weight | 172.08 |
| Purity | 98 |
| Density | 1.346g/cm3 |
| Boiling Point | 165.054ºC at 760 mmHg |
| Appearance | Liquid;Colorless to Light yellow to Light orange clear liquid |
| Storage Condition | room temperature |
| HTC | 2914700090 |
| PubChem ID | 32331773 |
| MDL Number | MFCD03419795 |
| SMILES | O=C(CC(=O)C(F)F)C(F)F |
| InChI | InChI=1S/C5H4F4O2/c6-4(7)2(10)1-3(11)5(8)9/h4-5H,1H2 |
| InChI Key | FTTDMWQQHZSARH-UHFFFAOYSA-N |
| MSDS | msds/91545_1_70086_62_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Dichloro-5-methoxymethyl-pyrimidine | 89380-14-3 | 2A-9091372 |
| 2,4-Dichloro-benzenesulfonicacid | 609-62-1 | 2A-9091395 |
| 2,4-DIBROMO-6-FLUOROPHENOL | 576-86-3 | 2A-9091421 |
| 2,4-Difluoro-benzenesulfonicacid | 46020-63-7 | 2A-9091449 |
| 2,4-Dichloro-5-ethoxymethyl-pyrimidine | 7627-39-6 | 2A-9091460 |
| 1-(2,4-DINITROPHENYL)-PIPERAZINE HCL | 31284-04-5 | 2A-9091602 |
| 1-(3-BROMOPROPOXY)-2,4-DICHLOROBENZENE | 6954-78-5 | 2A-9091720 |
| N-[2-(DiethylaMino)ethyl]-2,4-diMethyl-1H-pyrrole-3-CarboxaMide | 590424-05-8 | 2A-9091730 |
| 2,4-DIBROMOBIPHENYL | 53592-10-2 | 2A-9092813 |
| 2,4-DIAMINO-PHENOL | 34133-58-9 | 2A-9092935 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA