
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 83774-09-8 |
| Catalog No. | 2A-9091376 |
| Chinese Name | 2-氯-4-乙氧基嘧啶 |
| Synonyms | 2-Chloro-4-ethoxypyrimidine |
| Molecular Formula | C6H7ClN2O |
| Molecular Weight | 158.58600 |
| Density | 1.235 |
| Boiling Point | 279℃ |
| Melting Point | 35℃ |
| Appearance | Off-white to light yellow solid |
| Storage Condition | 2-8°C, inert gas |
| HTC | 2933599090 |
| PubChem ID | 6984201 |
| SMILES | CCOc1ccnc(Cl)n1 |
| InChI | InChI=1S/C6H7ClN2O/c1-2-10-5-3-4-8-6(7)9-5/h3-4H,2H2,1H3 |
| InChI Key | PXTBPZQWBZWDFS-UHFFFAOYSA-N |
| MSDS | msds/91376_1_83774_09_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-Chloro-2-methoxy-6-methyl-pyrimidine | 97041-37-7 | 2A-9091362 |
| 4-Chloro-2-ethoxy-pyrimidine | 92520-02-0 | 2A-9091365 |
| 4-Bromo-piperidine | 90633-18-4 | 2A-9091369 |
| 4-Chloro-6-methoxy-2-methylsulfanyl-pyrimidine | 89466-42-2 | 2A-9091370 |
| 4-Chloro-2-methanesulfonyl-6-methoxy-pyrimidine | 89466-55-7 | 2A-9091371 |
| 2-Bromo-4-bromomethyl-pyridine | 83004-14-2 | 2A-9091377 |
| 2-Iodomethyl-pyrrolidine | 5831-73-2 | 2A-9091381 |
| 4-Iodomethyl-piperidine | 4945-54-4 | 2A-9091385 |
| 1-Furan-2-yl-ethanol | 4208-64-4 | 2A-9091387 |
| 2-Bromomethyl-piperidine | 3433-38-3 | 2A-9091388 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA