
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 106344-20-1 |
| Catalog No. | 2A-9091351 |
| Chinese Name | Stannsoporfin |
| Synonyms | tin mesoporphyrin IX dichloride; Tin mesoporphyrin; Sn Mesoporphyrin; Stannsoporfin; Stanate |
| Molecular Formula | C34H36Cl2N4O4Sn |
| Molecular Weight | 754.29 |
| Purity | ≥98 (HPLC) |
| Boiling Point | 1096.1ºC at 760mmHg |
| Appearance | powder |
| Storage Condition | 2-8°C, sealed, dry |
| Application | Tin(IV) mesoporphyrin IX dichloride (Stannsoporfin) is a heme oxygenase (HO) inhibitor that was developed to prevent the development of jaundice from hyperbilirubinemia in infants. For detailed inform |
| SMILES | CC1=C(CCC(O)=O)/C2=C/C3=N/C(C(C)=C3CCC(O)=O)=C\C4=C(CC)C(C)=C(/C=C5N=C(C(C)=C\5CC)/C=C1\N26)N4[Sn]6(Cl)Cl |
| InChI | 1S/C34H38N4O4.2ClH.Sn/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;;;/h13-16H,7-12H2,1-6H3,(H4,35,36,37,38,39,40,41,42);2*1H;/q;;;+4/p-4/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-;;; |
| InChI Key | LLDZJTIZVZFNCM-UHEVNVKKSA-J |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/91351_1_106344_20_1.pdf |
| Transport Info | Product name: Sn (IV) mesoporphyrin IX dichloride |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl-piperidin-3-yl-amine | 150395-92-9 | 2A-9091345 |
| (6-Chloro-pyridin-3-ylmethyl)-isopropyl-amine | 120739-83-5 | 2A-9091346 |
| Ethyl-pyrrolidin-3-yl-amine | 111390-22-8 | 2A-9091347 |
| 4-hydroxy-N,N-diphenyl-(4R)-2-Pentynamide>98%byHPLC,>98%ee | 899809-61-1 | 2A-9091348 |
| Chrysarobin | 491-59-8 | 2A-9091349 |
| 2-amino-6-chlorophenol | 38191-33-2 | 2A-9091353 |
| 1-METHYL-1,5-DIHYDRO-4H-PYRAZOLO[3,4-D]PYRIMIDIN-4-ONE | 5334-56-5 | 2A-9091354 |
| 2-(3-fluorophenyl)-2-hydroxyacetonitrile | 143103-67-7 | 2A-9091355 |
| 2-Amino-benzenesulfonylchloride | 109061-25-8 | 2A-9091358 |
| (3-Chloro-quinoxalin-2-yl)-ethyl-amine | 99421-13-3 | 2A-9091361 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA