
CAS Number253177-03-6
Synonyms3-Iodomethylpiperidine-1-carboxylic acid tert-butyl ester; 1-Piperidinecarboxylic acid, 3-(iodomethyl)-, 1,1-dimethylethyl ester; 2-Methyl-2-propanyl 3-(iodomethyl)-1-piperidinecarboxylate; 1,4-Diaminecyclohexane
Molecular FormulaC11H20INO2
Molecular Weight325.186
Density1.4±0.1 g/cm3
Boiling Point336.6±15.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 253177-03-6 |
| Catalog No. | 2A-9091342 |
| Chinese Name | N-Boc-3-碘甲基哌啶 |
| Synonyms | 3-Iodomethylpiperidine-1-carboxylic acid tert-butyl ester; 1-Piperidinecarboxylic acid, 3-(iodomethyl)-, 1,1-dimethylethyl ester; 2-Methyl-2-propanyl 3-(iodomethyl)-1-piperidinecarboxylate; 1,4-Diaminecyclohexane |
| Molecular Formula | C11H20INO2 |
| Molecular Weight | 325.186 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 336.6±15.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, protected from light, dry and sealed |
| HTC | 2933399090 |
| PubChem ID | 34019323 |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CI)C1 |
| InChI | InChI=1S/C11H20INO2/c1-11(2,3)15-10(14)13-6-4-5-9(7-12)8-13/h9H,4-8H2,1-3H3 |
| InChI Key | GWYLEGFCHNTQTF-UHFFFAOYSA-N |
| MSDS | msds/91342_1_253177_03_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-Bromo-5-methoxymethyl-pyridine | 708273-70-5 | 2A-9091328 |
| 4-Ethylaminomethyl-piperidine-1-carboxylicacidtert-butylester | 614745-80-1 | 2A-9091329 |
| 4-Chloromethyl-piperidine-1-carboxylicacidtert-butylester | 479057-79-9 | 2A-9091334 |
| Piperidine-3-carbaldehyde | 353290-29-6 | 2A-9091338 |
| 1H-Imidazole-2-sulfonylchloride | 281221-70-3 | 2A-9091341 |
| 2-Iodomethyl-pyrrolidine-1-carboxylicacidtert-butylester | 177750-73-1 | 2A-9091344 |
| 2-Bromo-5-bromomethyl-pyridine | 101990-45-8 | 2A-9091359 |
| 4-Chloro-2-methoxy-6-methyl-pyrimidine | 97041-37-7 | 2A-9091362 |
| 4-Chloro-2-ethoxy-pyrimidine | 92520-02-0 | 2A-9091365 |
| 4-Bromo-piperidine | 90633-18-4 | 2A-9091369 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA