
CAS Number67500-19-0
Synonyms3-acetyl-4-flouroaniline; 1-(5-Amino-2-fluorophenyl)ethanone; Ethanone,1-(5-aMino-2-fluorophenyl); 3-acetyl-4-fluoroaniline; 1-(5-amino-2-fluoro-phenyl)-ethanone
Molecular FormulaC8H8FNO
Molecular Weight153.154
Density1.2±0.1 g/cm3
Boiling Point295.8±20.0 °C at 760 mmHg
Melting Point68-77°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 67500-19-0 |
| Catalog No. | 2A-9091277 |
| Chinese Name | 2-氟-5-氨基苯乙酮 |
| Synonyms | 3-acetyl-4-flouroaniline; 1-(5-Amino-2-fluorophenyl)ethanone; Ethanone,1-(5-aMino-2-fluorophenyl); 3-acetyl-4-fluoroaniline; 1-(5-amino-2-fluoro-phenyl)-ethanone |
| Molecular Formula | C8H8FNO |
| Molecular Weight | 153.154 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 295.8±20.0 °C at 760 mmHg |
| Melting Point | 68-77°C |
| Storage Condition | 2-8°C |
| HTC | 2922399090 |
| PubChem ID | 3218465 |
| SMILES | CC(=O)c1cc(N)ccc1F |
| InChI | InChI=1S/C8H8FNO/c1-5(11)7-4-6(10)2-3-8(7)9/h2-4H,10H2,1H3 |
| InChI Key | WYTBQTMYNBKLHE-UHFFFAOYSA-N |
| MSDS | msds/91277_1_67500_19_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| ETHYL3-(1-ADAMANTYL)-3-OXOPROPIONATE | 19386-06-2 | 2A-9091269 |
| 2,5-Dibromo-3-fluorochlorobenzene | 1000572-83-7 | 2A-9091270 |
| diacetoxyrhodiumorrhodiumacetate | 26105-49-7 | 2A-9091272 |
| 5-bromo2-isobutoxybenzonitirle | 876918-26-2 | 2A-9091273 |
| 2H-1-Benzopyran6-bromo-3,4,-dihydro4,4,-dimethyl | 1027915-16-7 | 2A-9091275 |
| (6-Bromo-pyridin-2-yl)-cyclopropyl-amine | 959237-20-8 | 2A-9091279 |
| (6-Chloro-2-methylsulfanyl-pyrimidin-4-yl)-cyclopropyl-amine | 951884-05-2 | 2A-9091281 |
| (6-Chloro-2-methylsulfanyl-pyrimidin-4-yl)-isopropyl-amine | 951884-54-1 | 2A-9091282 |
| (6-Chloro-pyrimidin-4-yl)-isopropyl-amine | 945896-32-2 | 2A-9091283 |
| (2-Chloro-pyrimidin-4-yl)-cyclopropyl-amine | 945895-52-3 | 2A-9091284 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA