
CAS Number33567-59-8
Synonymsm-methoxyphenylacetaldehyde; Benzeneacetaldehyde,2-methoxy; (2-Methoxy-phenyl)-acetaldehyd; (2-Methoxyphenyl)acetaldehyde; 2-(2-methoxyphenyl)ethanal
Molecular FormulaC9H10O2
Molecular Weight150.18
Density1.0±0.1 g/cm3
Boiling Point236.2±15.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 33567-59-8 |
| Catalog No. | 2A-9091076 |
| Chinese Name | 2-甲氧基苯乙醛 |
| Synonyms | m-methoxyphenylacetaldehyde; Benzeneacetaldehyde,2-methoxy; (2-Methoxy-phenyl)-acetaldehyd; (2-Methoxyphenyl)acetaldehyde; 2-(2-methoxyphenyl)ethanal |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 236.2±15.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2912499000 |
| PubChem ID | 409297 |
| MDL Number | MFCD00072185 |
| SMILES | COc1ccccc1CC=O |
| InChI | InChI=1S/C9H10O2/c1-11-9-5-3-2-4-8(9)6-7-10/h2-5,7H,6H2,1H3 |
| InChI Key | VKQKGJHUFQGOIX-UHFFFAOYSA-N |
| MSDS | msds/91076_1_33567_59_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 5-(chloromethyl)-1,2,3-trifluoro-Benzene | 732306-27-3 | 2A-9090889 |
| Methyll-bromo-cyclopropanecarboxylate | 96999-01-8 | 2A-9090907 |
| 4-Chloro-2-methoxy-benzaldehyde | 53581-86-5 | 2A-9090958 |
| 4-Fluoro-6-phenoxybenzaldehyde | 887267-45-0 | 2A-9090971 |
| {[4-(Bromomethyl)phenyl]sulfonyl}(4-fluorophenyl)amine | 260969-08-2 | 2A-9091009 |
| (4-ethoxyphenyl)acetaldehyde | 433229-42-6 | 2A-9091078 |
| Piperidine-4-boronicacid | 120347-72-0 | 2A-9091170 |
| 2-Fluoro-4-(Methylsulfonyl)Benzaldehyde | 119719-31-1 | 2A-9091183 |
| 3-amino-2,2-dimethylcyclobutanecarboxylate | 783260-98-0 | 2A-9091254 |
| N,N-Dimethylglycinehydrazidedihydrochloride | 5787-71-3 | 2A-9091263 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA