
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 845781-04-6 |
| Catalog No. | 2A-9091016 |
| Chinese Name | 4-N-丁基-3,4-二氟苯甲酮 |
| Synonyms | 4-n-Butyl-3',4'-difluorobenzophenone; PC2486; 4-butyl-3',4'-difluorobenzophenone |
| Molecular Formula | C17H16F2O |
| Molecular Weight | 274.30500 |
| Density | 1.134g/cm3 |
| Boiling Point | 377.2ºC at 760 mmHg |
| HTC | 2914700090 |
| PubChem ID | 3183875 |
| SMILES | CCCCc1ccc(C(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C17H16F2O/c1-2-3-4-12-5-7-13(8-6-12)17(20)14-9-10-15(18)16(19)11-14/h5-11H,2-4H2,1H3 |
| InChI Key | PRQKSSOAHRWKSW-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Bromo-3',3''-difluorotritylalcohol | 845790-81-0 | 2A-9091007 |
| 4-Bromo-4',4''-difluorotritylalcohol | 845790-77-4 | 2A-9091008 |
| 2,3-Bis(3-fluorophenyl)-5-phenyltetrazoliumchloride | 240800-46-8 | 2A-9091010 |
| 1-[4-Bromo-2-(hydroxymethyl)phenyl]-4-(dimethylamino)-1-(4-fluorophenyl)butan-1-ol | 488148-10-3 | 2A-9091013 |
| Ethyl-4-fluorocinnamate | 352-03-4 | 2A-9091014 |
| 4-(1-Butyl)-3',5'-difluorobenzophenone | 844885-13-8 | 2A-9091017 |
| 4-tert-Butyl-3',5'-difluorobenzophenone | 844885-10-5 | 2A-9091018 |
| 4-tert-Butyl-3'-fluorobenzhydrol | 844683-59-6 | 2A-9091019 |
| Propioamidinehydrochloride | 3599-89-1 | 2A-9091030 |
| Hydrazine,cyclopentyl-,dihydrochloride | 645372-27-6 | 2A-9091033 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA