
CAS Number6974-78-3
Synonyms8-Bromo-Adenine; 6-Amino-8-bromopurine; 8-bromo-1h-purin-6-amine; EINECS 230-225-1; 8-Bromo-9H-purin-6-ylamine; 8-Bromo-9H-purin-6-amine; 8-Br-adenine; 8-Bromo-1H-adenine
Molecular FormulaC5H4N5Br1
Molecular Weight214.02
Density2.14 g/cm3
Boiling Point497.5ºC
Melting Point>250℃
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6974-78-3 |
| Catalog No. | 2A-9090983 |
| Chinese Name | 8-溴腺嘌呤 |
| Synonyms | 8-Bromo-Adenine; 6-Amino-8-bromopurine; 8-bromo-1h-purin-6-amine; EINECS 230-225-1; 8-Bromo-9H-purin-6-ylamine; 8-Bromo-9H-purin-6-amine; 8-Br-adenine; 8-Bromo-1H-adenine |
| Molecular Formula | C5H4N5Br1 |
| Molecular Weight | 214.02 |
| Density | 2.14 g/cm3 |
| Boiling Point | 497.5ºC |
| Melting Point | >250℃ |
| Storage Condition | This product should be sealed and stored dry and b |
| HTC | 2933990090 |
| PubChem ID | 541959 |
| MDL Number | MFCD00037923 |
| SMILES | Nc1ncnc2nc(Br)[nH]c12 |
| InChI | InChI=1S/C5H4BrN5/c6-5-10-2-3(7)8-1-9-4(2)11-5/h1H,(H3,7,8,9,10,11) |
| InChI Key | FVXHPCVBOXMRJP-UHFFFAOYSA-N |
| MSDS | msds/90983_1_6974_78_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 6-amino-1H-Purine-2,8(3H,7H)-dione | 30377-37-8 | 2A-9090977 |
| 2-AMINO-6-HYDROXYPURINEHEMISULFATE | 10333-92-3 | 2A-9090979 |
| trans-4-(4-Fluorophenyl)-3-hydroxymethylpiperidine | 872544-48-4 | 2A-9090980 |
| 8-BROMOGUANINE | 3066-84-0 | 2A-9090981 |
| 2-Mercapto-4-hydroxy-5-fluoropyrimidine | 1542-23-0 | 2A-9090982 |
| 8-hydroxyguanine | 5814-64-2 | 2A-9090985 |
| 2-(4-Fluorophenyl)-4,6-diphenylpyridine | 91232-30-3 | 2A-9090986 |
| 4-(4-Fluorophenyl)-2,6-diphenylpyridine | 1498-83-5 | 2A-9090987 |
| 8-CHLOROGUANINE | 22052-03-5 | 2A-9091020 |
| 8-chloroadenine | 28128-28-1 | 2A-9091021 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA