
CAS Number115-32-2
Synonymsp,p'-Kelthane; 4,4'-Dichloro-a-(trichloromethyl)benzhydrol; Di(p-chlorophenyl)trichloromethylcarbinol; 4-chloro-α-(4-chlorophenyl)-α-(trichloromethyl)benzenemethanol; 4-Chloro-a-(4-chlorophenyl)-a-(trichloromethyl)benzenemethanol; Dicofol; 2,2,2-Trichloro-1,1-bis(4-chlorophenyl)ethanol; α,α,α,4,4'-pentachloro-α-methylbenzhydryl alcohol; p,p'-dicofol; 2,2,2-trichloro-1,1-bis(4-chlorophenyl)ethan-1-ol; 4,4'-Dichloro-α-(trichloromethyl)benzhydrol; EINECS 204-082-0; Dicofol standard solution; MFCD00055271
Molecular FormulaC14H9Cl5O
Molecular Weight370.49
Purity98%
Density1.5±0.1 g/cm3
Boiling Point454.7±40.0 °C at 760 mmHg
Melting Point78.5°C
AppearanceWhite or gray powder, or colorless crystal
EINECS204-082-0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 115-32-2 |
| Catalog No. | 2A-9009081 |
| Chinese Name | 三氯杀螨醇 |
| Synonyms | p,p'-Kelthane; 4,4'-Dichloro-a-(trichloromethyl)benzhydrol; Di(p-chlorophenyl)trichloromethylcarbinol; 4-chloro-α-(4-chlorophenyl)-α-(trichloromethyl)benzenemethanol; 4-Chloro-a-(4-chlorophenyl)-a-(trichloromethyl)benzenemethanol; Dicofol; 2,2,2-Trichloro-1,1-bis(4-chlorophenyl)ethanol; α,α,α,4,4'-pentachloro-α-methylbenzhydryl alcohol; p,p'-dicofol; 2,2,2-trichloro-1,1-bis(4-chlorophenyl)ethan-1-ol; 4,4'-Dichloro-α-(trichloromethyl)benzhydrol; EINECS 204-082-0; Dicofol standard solution; MFCD00055271 |
| Molecular Formula | C14H9Cl5O |
| Molecular Weight | 370.49 |
| Purity | 98 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 454.7±40.0 °C at 760 mmHg |
| Melting Point | 78.5°C |
| Appearance | White or gray powder, or colorless crystal |
| Water Solubility | Slightly soluble. |
| Storage Condition | The warehouse is ventilated and dried at low tempe |
| EINECS | 204-082-0 |
| HTC | 2906299010 |
| PubChem ID | 329755445 |
| MDL Number | MFCD00055271 |
| SMILES | OC(c1ccc(Cl)cc1)(c2ccc(Cl)cc2)C(Cl)(Cl)Cl |
| InChI | 1S/C14H9Cl5O/c15-11-5-1-9(2-6-11)13(20,14(17,18)19)10-3-7-12(16)8-4-10/h1-8,20H |
| InChI Key | UOAMTSKGCBMZTC-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1886299 |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/9081_1_115_32_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Aflatoxin M2 | 6885-57-0 | 2A-9009075 |
| Afurolol | 65776-67-2 | 2A-9009076 |
| Aganodine | 86696-87-9 | 2A-9009077 |
| Aglepristone | 124478-60-0 | 2A-9009078 |
| Agmatine | 306-60-5 | 2A-9009079 |
| Ajugarin I | 62640-05-5 | 2A-9009084 |
| Alacepril | 74258-86-9 | 2A-9009085 |
| Alanycarb | 83130-01-2 | 2A-9009086 |
| Alarelin acetate | 79561-22-1 | 2A-9009088 |
| bovine alpha-lactalbumin | 9051-29-0 | 2A-9009090 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA