![Benzenamine,3-[(4-chlorophenyl)methoxy]- structure, CAS 455280-08-7](/structures/100000/90801_2_455280_08_7.png)
CAS Number455280-08-7
Synonyms3-<(4-chlorobenzyl)amino>-1-hydroxypropane; 3-(4-chlorobenzylidene)indolin-2-one; 3-(4-Chlor-benzylamino)-propan-1-ol; 3-(4-chloro-benzylidene)-1,3-dihydro-indol-2-one; 3-(4-Chlor-benzylamino)-propanol-(1); N-(4-Chlorobenzyl)-N-(3-hydroxypropyl)amine; 3-(4-chlorobenzyloxy)aniline; 3-(4-chlorobenzylamino)propan-1-ol
Molecular FormulaC13H12ClNO
Molecular Weight233.69300
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 455280-08-7 |
| Catalog No. | 2A-9090801 |
| Chinese Name | 3-[(4-氯苯基)甲氧基]-苯胺 |
| Synonyms | 3-<(4-chlorobenzyl)amino>-1-hydroxypropane; 3-(4-chlorobenzylidene)indolin-2-one; 3-(4-Chlor-benzylamino)-propan-1-ol; 3-(4-chloro-benzylidene)-1,3-dihydro-indol-2-one; 3-(4-Chlor-benzylamino)-propanol-(1); N-(4-Chlorobenzyl)-N-(3-hydroxypropyl)amine; 3-(4-chlorobenzyloxy)aniline; 3-(4-chlorobenzylamino)propan-1-ol |
| Molecular Formula | C13H12ClNO |
| Molecular Weight | 233.69300 |
| Appearance | solid |
| Storage Condition | room temperature, dry |
| HTC | 2922299090 |
| PubChem ID | 41397214 |
| InChI | InChI=1S/C13H12ClNO/c14-11-6-4-10(5-7-11)9-16-13-3-1-2-12(15)8-13/h1-8H,9,15H2 |
| InChI Key | CHDORYQMOGJXJT-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(cyclobutylmethyl)hydrazine | 894101-37-2 | 2A-9090783 |
| Benzoicacid,2-[(3-bromophenyl)methoxy]- | 743453-43-2 | 2A-9090785 |
| SB-431542 | 301836-41-9 | 2A-9090786 |
| Benzeneacetamide,4-hydroxy-N-methyl- | 29121-34-4 | 2A-9090790 |
| "4-(4-NITROPHENYL)-3-BUTEN -2-ONE " | 3490-37-7 | 2A-9090798 |
| Avasimibe | 166518-60-1 | 2A-9090804 |
| Ethanamine,2-(2-chlorophenoxy)-,hydrochloride(1:1) | 26378-54-1 | 2A-9090808 |
| Acitazanolast | 114607-46-4 | 2A-9090813 |
| XL147 | 956958-53-5 | 2A-9090819 |
| Su-11274 | 658084-23-2 | 2A-9090821 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA