
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 84182-46-7 |
| Catalog No. | 2A-9090729 |
| Chinese Name | 3-苄氧基环丁烷-1,1-二羧酸 |
| Synonyms | 3-Benzyloxy-cyclobutan-1,1-dicarbonsaeure |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 |
| Density | 1.36g/cm3 |
| Boiling Point | 465.7ºC at 760 mmHg |
| Appearance | solid |
| HTC | 2918990090 |
| PubChem ID | 329818276 |
| MDL Number | MFCD11559004 |
| SMILES | O(C2CC(C2)(C(=O)O)C(=O)O)Cc1ccccc1 |
| InChI | 1S/C13H14O5/c14-11(15)13(12(16)17)6-10(7-13)18-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,15)(H,16,17) |
| InChI Key | LYRCCQROQBVCRV-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| MSDS | msds/90729_1_84182_46_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| CYCLOHEXYLCARBANILATE | 3770-95-4 | 2A-9090718 |
| Carbamicacid,(2,6-dichloro-4-pyridinyl)-,1,1-dimethylethylester(9CI) | 501907-61-5 | 2A-9090724 |
| 3-Pyridinamine,2-methoxy-N-(1-methylethyl)- | 112777-37-4 | 2A-9090725 |
| 1,1-Cyclobutanedicarboxylicacid,3-hydroxy-,1,1-diethylester | 99974-66-0 | 2A-9090727 |
| Canertinib | 267543-28-7 | 2A-9090728 |
| Carbamicacid,N-4-pyridinyl-,ethylester | 54287-92-2 | 2A-9090733 |
| Benzoicacid,4-amino-,2-phenylethylester | 65849-70-9 | 2A-9090739 |
| 2(1H)-Quinoxalinone,7-chloro- | 59489-30-4 | 2A-9090740 |
| Benzoicacid,4-[[(ethylamino)carbonyl]amino]- | 23754-41-8 | 2A-9090742 |
| 1-(4-bromo-2-nitrophenyl)ethanone | 90004-94-7 | 2A-9090745 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA