
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 206761-76-4 |
| Catalog No. | 2A-9090497 |
| Chinese Name | 5-甲基-4-苯基邻茴香胺 |
| Synonyms | 5-methyl-4-phenyl-o-anisidine |
| Molecular Formula | C18H18O2N4S1 |
| Molecular Weight | 354.43 |
| Density | 1.081g/cm3 |
| Boiling Point | 325.6ºC at 760 mmHg |
| Melting Point | 65ºC |
| HTC | 2922199090 |
| PubChem ID | 3187587 |
| MDL Number | MFCD02228332 |
| SMILES | COc1cc(-c2ccccc2)c(C)cc1N |
| InChI | InChI=1S/C14H15NO/c1-10-8-13(15)14(16-2)9-12(10)11-6-4-3-5-7-11/h3-9H,15H2,1-2H3 |
| InChI Key | NLPFRHHIACJMBY-UHFFFAOYSA-N |
| MSDS | msds/90497_1_206761_76_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Chloro-6-(4-chlorophenyl)pyridazin-3(2H)-one | 80591-41-9 | 2A-9090472 |
| N-Methyl-(1-phenyl-3-pyrrolidin-1-yl-propyl)amine | 672310-28-0 | 2A-9090484 |
| N-Methyl-2-methylamino-N-phenylacetamidehydrochloride | 877879-80-6 | 2A-9090486 |
| 4-(4-Methyl-3-nitrophenyl)thiazol-2-ylamine | 675602-95-6 | 2A-9090489 |
| alpha-Methyl-4-(methylsulfonyl)benzylamine | 387350-90-5 | 2A-9090490 |
| N-Methyl-N-[4-(methylsulfonyl)-2-nitrophenyl]amine | 30388-44-4 | 2A-9090498 |
| N-Methyl-N'-octylethylenediamine | 886499-97-4 | 2A-9090500 |
| benzo[b]thiophen-3-amine | 149338-13-6 | 2A-9090507 |
| (2-(trifluoromethoxy)phenyl)acrylicacid | 399580-48-4 | 2A-9090508 |
| 3-oxocyclopent-1-enecarboxylicacid | 108384-36-9 | 2A-9090510 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA