
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51114-73-9 |
| Catalog No. | 2A-9089891 |
| Chinese Name | 5-硝基-A-四氢萘酮 |
| Synonyms | 5-nitro-3,4-dihydro-2H-naphthalen-1-one; 5-Nitro-3,4-dihydro-1(2H)-naphthalenone |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 |
| Purity | 98 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 349.9±31.0 °C at 760 mmHg |
| Appearance | white solid |
| Storage Condition | 2~8℃ |
| HTC | 2914700090 |
| MDL Number | MFCD00667654 |
| SMILES | O=C1CCCc2c1cccc2[N+](=O)[O-] |
| InChI Key | HXTWAFNCOABMPL-UHFFFAOYSA-N |
| MSDS | msds/89891_1_51114_73_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5,6,7,8-tetrahydro-1,6-naphthyridin-2(1H)-one | 676994-64-2 | 2A-9089874 |
| 2-(6-Amino-9H-purin-9-yl)ethoxymethylphosphoricacid | 276873-12-2 | 2A-9089877 |
| 2-(4-Fluorophenoxy)-1-{6-[1-(4-fluorophenoxy)ethyl]pyridin-3-yl}propan-1-one | 866149-83-9 | 2A-9089880 |
| 2-(Pyridin-4-yl)-2,3-dihydroquinazolin-4(1H)-one | 15495-00-8 | 2A-9089884 |
| 2-amino-5-chloro-4-nitrobenzoicacid | 34649-02-0 | 2A-9089886 |
| 3-methoxypyridin-4-amine | 52334-90-4 | 2A-9089893 |
| 3,4-dihydro-2H-benzo[b][1,4]oxazin-7-ol | 104535-37-7 | 2A-9089902 |
| 7-hydroxy-2H-benzo[b][1,4]oxazin-3(4H)-one | 67193-97-9 | 2A-9089903 |
| 1-Chloro-5-fluoro-2-(4-fluorobenzyloxy)-4-nitrobenzene | 439095-66-6 | 2A-9089905 |
| 4-bromo-2-(carboxymethyl)benzoicacid | 943749-63-1 | 2A-9089910 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA