
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 65148-70-1 |
| Catalog No. | 2A-9089803 |
| Chinese Name | 3-甲基扁桃酸 |
| Synonyms | hydroxy-m-tolyl-acetic acid; D-3-methyl-mandelic acid; 3-Methylmandelic acid; 2-m-tolyl-2-hydroxyethanoic acid; m-methylmandelic acid |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.17400 |
| Density | 1.264g/cm3 |
| Boiling Point | 332.6ºC at 760 mmHg |
| HTC | 2918199090 |
| SMILES | Cc1cccc(C(O)C(=O)O)c1 |
| InChI | InChI=1S/C9H10O3/c1-6-3-2-4-7(5-6)8(10)9(11)12/h2-5,8,10H,1H3,(H,11,12) |
| InChI Key | ASTGXUHKUFFOQX-UHFFFAOYSA-N |
| MSDS | msds/89803_1_65148_70_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,3'-Dimethyl-3''-methyltritylalcohol | 51226-48-3 | 2A-9089789 |
| 3,3'-Dimethyl-4''-methyltritylalcohol | 845790-68-3 | 2A-9089790 |
| 4,4'-Dimethyl-3''-methyltritylalcohol | 845790-67-2 | 2A-9089791 |
| 3-Methyl-4'-(methylthio)benzhydrol | 844683-33-6 | 2A-9089801 |
| 4-Methyl-4'-(methylthio)benzhydrol | 842140-63-0 | 2A-9089802 |
| 3,3',4-Trichlorobenzhydrol | 844683-48-3 | 2A-9089805 |
| 3,4,4'-Trichlorobenzhydrol | 660840-68-6 | 2A-9089806 |
| 4-Methyl-3-benzyloxybenzylalcohol | 916792-34-2 | 2A-9089808 |
| 1-(2,6-Dimethoxybenzyl)piperidin-4-one | 397244-87-0 | 2A-9089811 |
| (4-Phenoxyphenyl)piperidin-1-yl-methanethione | 959235-74-6 | 2A-9089812 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA