
CAS Number24095-40-7
Synonyms[4-(Aminomethyl)phenyl](phenyl)methanone hydrochloride (1:1); 4-benzoylbenzylamine hydrochloride; Methanone, [4-(aminomethyl)phenyl]phenyl-, hydrochloride (1:1)
Molecular FormulaC14H14ClNO
Molecular Weight247.720
Boiling Point97-99/0.38mm
Melting Point122-125ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 24095-40-7 |
| Catalog No. | 2A-9089698 |
| Chinese Name | 4-苯甲酰基苄胺盐酸盐 |
| Synonyms | [4-(Aminomethyl)phenyl](phenyl)methanone hydrochloride (1:1); 4-benzoylbenzylamine hydrochloride; Methanone, [4-(aminomethyl)phenyl]phenyl-, hydrochloride (1:1) |
| Molecular Formula | C14H14ClNO |
| Molecular Weight | 247.720 |
| Boiling Point | 97-99/0.38mm |
| Melting Point | 122-125ºC |
| Storage Condition | 2-8℃, inert gas storage |
| HTC | 2922399090 |
| SMILES | Cl.NCc1ccc(C(=O)c2ccccc2)cc1 |
| InChI Key | XCBRWBLKNAXUAM-UHFFFAOYSA-N |
| MSDS | msds/89698_1_24095_40_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (Z)-2-(2-Aminothiazol-4-yl)-2-acetyloxyiminoaceticacid | 110130-88-6 | 2A-9089690 |
| (Z)-2-(5-Amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoaceticacid | 75028-24-9 | 2A-9089691 |
| Benzofurazan-4-sulfonamide | 114322-13-3 | 2A-9089695 |
| 4-[(E)-2-(1H-Benzoimidazol-2-yl)vinyl]phenylamine | 28940-48-9 | 2A-9089696 |
| 5-Benzooxazol-2-yl-2-chlorophenylamine | 313701-55-2 | 2A-9089697 |
| 2-Nitro-5-phenoxyphenylamine | 1552-17-6 | 2A-9089699 |
| 3-Nitro-N-(phenylsulfonyl)benzenesulfonamide | 69173-32-6 | 2A-9089701 |
| 4-Nitro-N-(phenylsulfonyl)benzenesulfonamide | 64299-39-4 | 2A-9089704 |
| Cinnamyl3-aminocrotonate | 113898-97-8 | 2A-9089706 |
| (4-Amino-3-nitrophenyl)(4-fluorophenyl)methanone | 31431-26-2 | 2A-9089708 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA