
CAS Number608-73-1
SynonymsHexachlorocyclohexane; 2,3,4,5,6,6-hexachloro-2,4-cyclohexadien-1-one; MFCD00003825; benzene hexachloride; HCH; EINECS 206-270-8; Hexachloro-C6one; hexachloro-cyclohexadienone; 2,3,4,5,6,6-hexachloro-2,4-cyclohexadienone; 2,2,3,4,5,6-hexachloro-cyclohexa-2,4-dien-1-one; 1,2,3,4,5,6-hexachlorocyclo-hexane; BHC; hexachlor; hexachloran; 2,3,4,5,6,6-hexachloro-2,4-cyclohexadiene-1-one
Molecular FormulaC6H6Cl6
Molecular Weight290.83
Purity98%
Density1.59g/cm3
Boiling Point288ºC at 760 mmHg
Melting Point141.5ºC
AppearancePowder or Flakes
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 608-73-1 |
| Catalog No. | 2A-9008952 |
| Chinese Name | BHC(六氯环己烷的混合物) |
| Synonyms | Hexachlorocyclohexane; 2,3,4,5,6,6-hexachloro-2,4-cyclohexadien-1-one; MFCD00003825; benzene hexachloride; HCH; EINECS 206-270-8; Hexachloro-C6one; hexachloro-cyclohexadienone; 2,3,4,5,6,6-hexachloro-2,4-cyclohexadienone; 2,2,3,4,5,6-hexachloro-cyclohexa-2,4-dien-1-one; 1,2,3,4,5,6-hexachlorocyclo-hexane; BHC; hexachlor; hexachloran; 2,3,4,5,6,6-hexachloro-2,4-cyclohexadiene-1-one |
| Molecular Formula | C6H6Cl6 |
| Molecular Weight | 290.83 |
| Purity | 98 |
| Density | 1.59g/cm3 |
| Boiling Point | 288ºC at 760 mmHg |
| Melting Point | 141.5ºC |
| Appearance | Powder or Flakes |
| Storage Condition | Storage: Seal the container and store it in a seal |
| Packaging | III |
| MDL Number | MFCD00135948 |
| SMILES | Cl[C@H]1[C@H](Cl)[C@@H](Cl)[C@H](Cl)[C@@H](Cl)[C@@H]1Cl |
| InChI | 1S/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H/t1-,2-,3+,4+,5-,6- |
| InChI Key | JLYXXMFPNIAWKQ-CDRYSYESSA-N |
| Beilstein/REAXYS | 1907338 |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/8952_1_608_73_1.pdf |
| Related Products in Industrial Applications | ||
|---|---|---|
| N-(4-Aminobenzoyl)aminoethanol | 54472-45-6 | 2A-9008354 |
| N,N-Diethylethanolamine | 100-37-8 | 2A-9008391 |
| Octafluorotoluene | 434-64-0 | 2A-9008626 |
| Piperonylonitrile | 4421-09-4 | 2A-9008682 |
| Pyridinium 4-toluenesulfonate | 24057-28-1 | 2A-9008713 |
| Ammoniated Mercury | 33445-15-7 | 2A-9009168 |
| Niclosamidel; Niclosamide ethanolamine salt | 1420-04-8 | 2A-9011637 |
| Oleylethanolamide | 111-58-0 | 2A-9011754 |
| piperonyl acetone | 3160-37-0 | 2A-9012032 |
| 1,2,3,4,5,6-Cyclohexanehexol | 87-89-8 | 2A-9013035 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA