
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 845823-06-5 |
| Catalog No. | 2A-9089149 |
| Chinese Name | 3-氟-4-甲基-2,2,2-三氟苯乙酮 |
| Synonyms | Exact Mass 206.03500; PSA 17.07000; LogP 2.87910; Index of Refraction 1.439; InChIKey GMGYOGJDXAFXGX-UHFFFAOYSA-N |
| Molecular Formula | C14H17Cl3FN3OS |
| Molecular Weight | 400.732 |
| Density | 1.306g/cm3 |
| Boiling Point | 200.9ºC at 760 mmHg |
| HTC | 2914700090 |
| MDL Number | MFCD00225640 |
| SMILES | Cc1ccc(C(=O)C(F)(F)F)cc1F |
| InChI Key | GMGYOGJDXAFXGX-UHFFFAOYSA-N |
| MSDS | msds/89149_1_845823_06_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-tert-Butyl-N'-propylethylenediamine | 886500-79-4 | 2A-9089144 |
| 4-(3-Butylureido)-2-chlorobenzenesulfonylchloride | 728864-78-6 | 2A-9089145 |
| 4-Fluoro-3-methylthiophenol | 845790-87-6 | 2A-9089146 |
| 5-(3-Butylureido)-2-ethoxybenzenesulfonylchloride | 680618-18-2 | 2A-9089147 |
| 4-(3-Butylureido)-2-methylbenzenesulfonylchloride | 678185-73-4 | 2A-9089148 |
| 5-Butyrylaminonaphthalene-1-sulfonylchloride | 728864-72-0 | 2A-9089150 |
| 4'-Fluoro-3'-methyl-2,2,2-trifluoroacetophenone | 845823-10-1 | 2A-9089151 |
| 4-Fluoronaphthalene-1-sulfonylchloride | 316-69-8 | 2A-9089153 |
| 2,6-Dimethoxy-4-[(1-phenylethylamino)methyl]phenol | 680185-62-0 | 2A-9089155 |
| 4-(Dimethylamino)benzhydrol | 7494-77-1 | 2A-9089156 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA