
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 844885-30-9 |
| Catalog No. | 2A-9088892 |
| Chinese Name | 4-(1-BUTYL)-3',4'-DICHLOROBENZOPHENONE |
| Synonyms | 4-n-Butyl-3',4'-dichlorobenzophenone |
| Molecular Formula | C17H16Cl2O |
| Molecular Weight | 233.28 |
| Density | 1.194g/cm3 |
| Boiling Point | 431.1ºC at 760 mmHg |
| Appearance | solid |
| HTC | 2914700090 |
| PubChem ID | 329815796 |
| MDL Number | MFCD04115094 |
| SMILES | CC(C)(C)c1cc(N)n(n1)-c2ccc(F)cc2 |
| InChI | 1S/C13H16FN3/c1-13(2,3)11-8-12(15)17(16-11)10-6-4-9(14)5-7-10/h4-8H,15H2,1-3H3 |
| InChI Key | BYZGQEFEOZXWRO-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352116 |
| MSDS | msds/88892_1_844885_30_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Fluoro-2-(4-fluorobenzoyl)benzenecarboxylicacid | 338982-44-8 | 2A-9088885 |
| 4-tert-Butyl-3'-chlorobenzophenone | 93977-28-7 | 2A-9088886 |
| 4-tert-Butyl-4'-chlorobenzophenone | 67743-49-1 | 2A-9088888 |
| 2-amino-6-(methylamino)-5-nitropyrimidin-4(3H)-one | 879-44-7 | 2A-9088889 |
| 5'-Fluoro-2'-hydroxy-3'-nitroacetophenone | 70978-39-1 | 2A-9088890 |
| 4-tert-Butyl-3',4'-dichlorobenzophenone | 844885-27-4 | 2A-9088894 |
| 4-tert-Butyl-4'-methylbenzophenone | 55709-38-1 | 2A-9088896 |
| 2-tert-butylpyrimidin-4-amine | 114362-20-8 | 2A-9088897 |
| 3-(4-(1-Butyl)phenyl)-1-propene | 842124-16-7 | 2A-9088898 |
| 4-(5-Fluoro-2,3-dihydro-1H-indol-1-yl)-4-oxobutanoicacid | 393183-92-1 | 2A-9088899 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA