![4-[(4-Fluorobenzyl)oxy]-3-methoxybenzenecarboxaldehyde structure, CAS 321432-05-7](/structures/100000/88852_1_321432_05_7.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 321432-05-7 |
| Catalog No. | 2A-9088852 |
| Chinese Name | 4-(4-氟苄氧基)-3-甲氧基苯甲醛 |
| Synonyms | MFCD00202628 |
| Molecular Formula | C15H13FO3 |
| Molecular Weight | 260.26000 |
| Density | 1.216g/cm3 |
| Boiling Point | 397.4ºC at 760 mmHg |
| Melting Point | 80-82ºC |
| Appearance | solid |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2913000090 |
| SMILES | COc1cc(C=O)ccc1OCc1ccc(F)cc1 |
| InChI Key | PGCCPVWYLPJNBO-UHFFFAOYSA-N |
| MSDS | msds/88852_1_321432_05_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3,5-Bis(trifluoromethyl)phenylthioethanol | 450409-97-9 | 2A-9088812 |
| 3,5-Bis(trifluoromethyl)thioanisole | 685892-24-4 | 2A-9088822 |
| 2,4-Bis(trifluoromethyl)toluene | 136664-96-5 | 2A-9088825 |
| 2-Bromo-5-(trifluoromethyl)benzylbromide | 886496-63-5 | 2A-9088843 |
| Benzene,1-bromo-2-isothiocyanato-3-nitro-5-(trifluoromethyl)- | 688763-24-8 | 2A-9088845 |
| [4,5-Dimethoxy-2-(4-trifluoromethylsulfanylphenylsulfamoyl)phenyl]aceticacid | 886499-12-3 | 2A-9088856 |
| 2-Dimethylamino-6-trifluoromethyl[1,3]oxazin-4-one | 188616-68-4 | 2A-9088858 |
| 3'-Fluorobiphenyl-2-carbaldehyde | 676348-32-6 | 2A-9088864 |
| 3'-Fluorobiphenyl-3-carbaldehyde | 400750-09-6 | 2A-9088865 |
| 2-(4-Trifluoromethylthiobenzoxy)-5-nitrotoluene | 1245808-66-5 | 2A-9088929 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA