
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 36978-51-5 |
| Catalog No. | 2A-9088841 |
| Chinese Name | 5-(3-甲基苯基)-5-氧代戊酸 |
| Synonyms | 5-(3-Methylphenyl)-5-oxovaleric acid |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.204 |
| Density | 1.137g/cm3 |
| Boiling Point | 399.8ºC at 760 mmHg |
| Melting Point | 112-114ºC |
| HTC | 2918300090 |
| MDL Number | MFCD06199358 |
| SMILES | Cc1cccc(C(=O)CCCC(=O)O)c1 |
| InChI Key | GSOIUFKUQPXOKP-UHFFFAOYSA-N |
| MSDS | msds/88841_1_36978_51_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(3-Methylphenyl)-4-oxobutyricacid | 59618-44-9 | 2A-9088836 |
| 2-Bromo-4-(trifluoromethoxy)iodobenzene | 883546-30-3 | 2A-9088837 |
| 3-(4-Fluorobenzyloxy)bromobenzene | 845866-52-6 | 2A-9088838 |
| 5-(2-Methylphenyl)-5-oxovalericacid | 36978-50-4 | 2A-9088839 |
| 3-Bromo-4-(trifluoromethoxy)phenol | 886496-88-4 | 2A-9088840 |
| 2-Chlorobenzyl4-bromophenylketone | 1152687-29-0 | 2A-9088846 |
| 4-Chlorobenzyl4-bromophenylketone | 107028-33-1 | 2A-9088848 |
| 4-(4-Fluorobenzyloxy)chlorobenzene | 332-04-7 | 2A-9088849 |
| 1-Bromo-4-(trifluorovinyloxy)benzene | 134151-77-2 | 2A-9088851 |
| N-Butyl-N'-2,2,2-trifluoroethylethylenediamine | 886503-62-4 | 2A-9088854 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA