
CAS Number6939-36-2
Synonyms4-oxo-4-o-tolyl-butyric acid; 4-(2-Methylphenyl)-4-oxobutanoic acid; 4-Oxo-4-o-tolyl-buttersaeure; 4-(2-Methylphenyl)-4-oxobutyric acid
Molecular FormulaC24H19NO2
Molecular Weight353.425
Density1.2±0.1 g/cm3
Boiling Point371.7±25.0 °C at 760 mmHg
Melting Point102-105ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6939-36-2 |
| Catalog No. | 2A-9088835 |
| Chinese Name | 4-(2-甲基苯基)-4-氧代丁酸 |
| Synonyms | 4-oxo-4-o-tolyl-butyric acid; 4-(2-Methylphenyl)-4-oxobutanoic acid; 4-Oxo-4-o-tolyl-buttersaeure; 4-(2-Methylphenyl)-4-oxobutyric acid |
| Molecular Formula | C24H19NO2 |
| Molecular Weight | 353.425 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 371.7±25.0 °C at 760 mmHg |
| Melting Point | 102-105ºC |
| HTC | 2918300090 |
| MDL Number | MFCD02188716 |
| SMILES | Cc1ccccc1C(=O)CCC(=O)O |
| InChI | InChI=1S/C11H12O3/c1-8-4-2-3-5-9(8)10(12)6-7-11(13)14/h2-5H,6-7H2,1H3,(H,13,14) |
| InChI Key | XESJRHLXEFHLPK-UHFFFAOYSA-N |
| MSDS | msds/88835_1_6939_36_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4'-(3-Fluorobenzyloxy)acetophenone | 93291-55-5 | 2A-9088829 |
| Methyl3-isocyano-3-phenylpropionate | 730971-58-1 | 2A-9088830 |
| Methyl3-isocyano-4-methylbenzoate | 730964-94-0 | 2A-9088832 |
| 3-(3-Fluorobenzyloxy)bromobenzene | 845866-57-1 | 2A-9088833 |
| 1-(2-Bromotetrafluoroethyl)cyclohexene | 113688-49-6 | 2A-9088834 |
| 4-(3-Methylphenyl)-4-oxobutyricacid | 59618-44-9 | 2A-9088836 |
| 2-Bromo-4-(trifluoromethoxy)iodobenzene | 883546-30-3 | 2A-9088837 |
| 3-(4-Fluorobenzyloxy)bromobenzene | 845866-52-6 | 2A-9088838 |
| 5-(2-Methylphenyl)-5-oxovalericacid | 36978-50-4 | 2A-9088839 |
| 3-Bromo-4-(trifluoromethoxy)phenol | 886496-88-4 | 2A-9088840 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA