
CAS Number5333-34-6
Synonyms3-veratroylpropionic acid; 4-(3,4-dimethoxyphenyl)-4-oxopropionic acid; 4-(3,4-Dimethoxy-phenyl)-4-oxo-butyric acid; 3-(3',4'-dimethoxybenzoyl)propionic acid; MFCD00033286
Molecular FormulaC12H14O5
Molecular Weight238.242
Density1.211 g/cm3
Boiling Point432.9ºC at 760 mmHg
Melting Point159-161ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5333-34-6 |
| Catalog No. | 2A-9088786 |
| Chinese Name | 4-(3,4-二甲氧基苯基)-4-氧代丁酸 |
| Synonyms | 3-veratroylpropionic acid; 4-(3,4-dimethoxyphenyl)-4-oxopropionic acid; 4-(3,4-Dimethoxy-phenyl)-4-oxo-butyric acid; 3-(3',4'-dimethoxybenzoyl)propionic acid; MFCD00033286 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.242 |
| Density | 1.211 g/cm3 |
| Boiling Point | 432.9ºC at 760 mmHg |
| Melting Point | 159-161ºC |
| Storage Condition | Store at room temperature, away from light, in a c |
| HTC | 2918990090 |
| MDL Number | MFCD00033286 |
| SMILES | COc1ccc(C(=O)CCC(=O)O)cc1OC |
| InChI | InChI=1S/C12H14O5/c1-16-10-5-3-8(7-11(10)17-2)9(13)4-6-12(14)15/h3,5,7H,4,6H2,1-2H3,(H,14,15)/p-1 |
| InChI Key | BUAYFJKMVBIPKA-UHFFFAOYSA-N |
| MSDS | msds/88786_1_5333_34_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-Diisothiocyanatobenzoicacid | 151890-10-7 | 2A-9088772 |
| N-(4-Fluorobenzylidene)-4-methylbenzenesulfonamide | 193675-43-3 | 2A-9088775 |
| 2-[1-(4-Fluorobenzyl)-1H-indol-3-yl]aceticacid | 176204-51-6 | 2A-9088780 |
| 2',4'-Dimethoxybiphenyl-3-carboxylicacid | 728919-16-2 | 2A-9088781 |
| 2',4'-Dimethoxybiphenyl-4-carboxylicacid | 108474-22-2 | 2A-9088783 |
| 2-(2-Chlorobenzyl)-3-oxo-butyricacidmethylester | 676348-55-3 | 2A-9088788 |
| (2'-Chlorobiphenyl-2-yl)aceticacid | 669713-77-3 | 2A-9088791 |
| (2'-Chlorobiphenyl-3-yl)aceticacid | 669713-78-4 | 2A-9088794 |
| 2-Fluorobenzylmethylsulfone | 25195-45-3 | 2A-9088795 |
| (3-Chlorobiphenyl-2-yl)aceticacid | 62326-30-1 | 2A-9088798 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA