CAS Number13871-68-6
SynonymsUNII:1IED47A544; 4-Aminobenzeneacetic acid; p-Aminophenylacetic Acid; p-aminophenyl acetate; 4-Aminophenyl acetate HCl; MFCD00007916; 4-aminophenyl acetate; 4-acetoxyaminoquinoline; 4-acetoxyaniline; EINECS 214-828-7; 4-Aminophenylacetic acid; (para-Aminophenyl)acetic acid; 4-aminophenol acetate; p-amino-O-acetylphenol
Molecular FormulaC8H9NO2
Molecular Weight151.163
Density1.3±0.1 g/cm3
Boiling Point344.0±17.0 °C at 760 mmHg
Melting Point201ºC (dec.)(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13871-68-6 |
| Catalog No. | 2A-9088639 |
| Chinese Name | 4-氨基苯基醋酸盐 |
| Synonyms | UNII:1IED47A544; 4-Aminobenzeneacetic acid; p-Aminophenylacetic Acid; p-aminophenyl acetate; 4-Aminophenyl acetate HCl; MFCD00007916; 4-aminophenyl acetate; 4-acetoxyaminoquinoline; 4-acetoxyaniline; EINECS 214-828-7; 4-Aminophenylacetic acid; (para-Aminophenyl)acetic acid; 4-aminophenol acetate; p-amino-O-acetylphenol |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.163 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 344.0±17.0 °C at 760 mmHg |
| Melting Point | 201ºC (dec.)(lit.) |
| Storage Condition | room temperature, dry |
| HTC | 2922199090 |
| SMILES | CC(=O)Oc1ccc(N)cc1 |
| InChI | InChI=1S/C8H9NO2/c1-6(10)11-8-4-2-7(9)3-5-8/h2-5H,9H2,1H3 |
| InChI Key | QVJWBJWRAPJXNM-UHFFFAOYSA-N |
| MSDS | msds/88639_1_13871_68_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(1,2,4-Triazol-1-yl)benzylAlcohol | 143426-50-0 | 2A-9088631 |
| 3-Chlorobenzotrichloride | 2136-81-4 | 2A-9088632 |
| 4-MorpholinobenzylAlcohol | 280556-71-0 | 2A-9088634 |
| 3-(2-Thienyl)-1-propanol | 19498-72-7 | 2A-9088636 |
| 2-(4-Isopropylphenylthio)benzoicacid | 5495-75-0 | 2A-9088637 |
| 2-[(2-Chlorophenyl)acetyl]benzoicacid | 1174006-03-1 | 2A-9088642 |
| 2,2-Dimethylphenylaceticacid | 39192-75-1 | 2A-9088643 |
| 4-(1,3-Oxazol-5-yl)phenol | 1128-71-8 | 2A-9088645 |
| Ethyl2-(2,3-dimethylphenyl)acetate | 105337-79-9 | 2A-9088646 |
| 3-(4-Nitrophenoxy)benzoicacid | 27237-21-4 | 2A-9088647 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS