
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7170-45-8 |
| Catalog No. | 2A-9088282 |
| Chinese Name | 3-(2-氯苯氧基)丙酸 |
| Synonyms | MFCD02295728 |
| Molecular Formula | C9H9ClO3 |
| Molecular Weight | 200.61900 |
| Density | 1.311g/cm3 |
| Boiling Point | 305.6ºC at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2918990090 |
| SMILES | OC(=O)CCOc1ccccc1Cl |
| InChI | InChI=1S/C9H9ClO3/c10-7-3-1-2-4-8(7)13-6-5-9(11)12/h1-4H,5-6H2,(H,11,12) |
| InChI Key | InChIKey=UZFYWLRSVDZCSF-UHFFFAOYSA-N |
| MSDS | msds/88282_1_7170_45_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(4-Methoxyphenoxy)propionicAcid | 20811-60-3 | 2A-9088272 |
| 3-(3-Methoxyphenoxy)propionicAcid | 49855-03-0 | 2A-9088274 |
| 3-(2-Methoxyphenoxy)propionicAcid | 20370-80-3 | 2A-9088276 |
| Methyl2-(Imidazol-1-yl)acetate | 25023-22-7 | 2A-9088279 |
| 3-(3-Chlorophenoxy)propionicAcid | 7170-50-5 | 2A-9088280 |
| 7-Bromo-1,2,3,4-tetrahydro-acridine-9-carboxylicacid | 37509-14-1 | 2A-9088304 |
| 3-(4-Cyanophenoxy)propionicAcid | 58228-89-0 | 2A-9088313 |
| 3-(Morpholinomethyl)benzoicAcid | 67451-81-4 | 2A-9088323 |
| 3-(1-Pyrrolidylmethyl)benzoicAcidHydrochloride | 887922-93-2 | 2A-9088327 |
| Methyl3-(Morpholinomethyl)benzoate | 190660-95-8 | 2A-9088329 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA