
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6336-59-0 |
| Catalog No. | 2A-9088245 |
| Chinese Name | 3-(2-硝基苯氧基)丙酸 |
| Synonyms | 3-(2-Nitro-phenoxy)-propionsaeure; 3-(2-nitrophenyloxy)propionic acid; 3-(2-NITROPHENOXY)PROPIONIC ACID; 3-(o-nitrophenoxy)propionic acid |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.176 |
| Density | 1.38g/cm3 |
| Boiling Point | 373.7ºC at 760 mmHg |
| HTC | 2918990090 |
| MDL Number | MFCD00225414 |
| SMILES | O=C(O)CCOc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9NO5/c11-9(12)5-6-15-8-4-2-1-3-7(8)10(13)14/h1-4H,5-6H2,(H,11,12) |
| InChI Key | AKIYJDFJPJUROC-UHFFFAOYSA-N |
| MSDS | msds/88245_1_6336_59_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(2-Aminoethoxy)benzamide | 58932-30-2 | 2A-9088216 |
| 4-(3-Aminopropoxy)benzamide | 1018600-42-4 | 2A-9088218 |
| 2-(3-Aminopropoxy)benzamide | 1016533-62-2 | 2A-9088220 |
| 3-(4-Nitrophenoxy)propionicAcid | 10572-16-4 | 2A-9088226 |
| 3-(3-Nitrophenoxy)propionicAcid | 91004-46-5 | 2A-9088229 |
| (4-Cyanophenoxy)aceticAcid | 1878-82-6 | 2A-9088246 |
| (3-Cyanophenoxy)aceticAcid | 1879-58-9 | 2A-9088250 |
| (2-Cyanophenoxy)aceticAcid | 6574-95-4 | 2A-9088258 |
| (4-Carbamoylphenoxy)aceticAcid | 29936-86-5 | 2A-9088260 |
| [2-(Methylthio)phenoxy]aceticAcid | 3395-40-2 | 2A-9088263 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA