
CAS Number114873-08-4
SynonymsExact Mass 338.103333; PSA 91.42000; LogP 3.67; Index of Refraction 1.609; InChIKey PZZXAZAYKCNQAL-ZDUSSCGKSA-N
Molecular FormulaC16H19ClN2O4
Molecular Weight526.65
Purity≥98.0 (TLC)%
Density1.3±0.1 g/cm3
Boiling Point560.8±50.0 °C at 760 mmHg
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 114873-08-4 |
| Catalog No. | 2A-9088174 |
| Chinese Name | L-N-Boc-5-氯色氨酸 |
| Synonyms | Exact Mass 338.103333; PSA 91.42000; LogP 3.67; Index of Refraction 1.609; InChIKey PZZXAZAYKCNQAL-ZDUSSCGKSA-N |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 526.65 |
| Purity | ≥98.0 (TLC) |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 560.8±50.0 °C at 760 mmHg |
| Appearance | powder |
| Storage Condition | room temperature, dry |
| HTC | 2933990090 |
| PubChem ID | 57647271 |
| MDL Number | MFCD00236821 |
| SMILES | Cc1c(C)c(c(C)c2CC(C)(C)Oc12)S(=O)(=O)NC(=N)NCCC[C@H](NC(=O)OC(C)(C)C)C(O)=O |
| InChI | 1S/C24H38N4O7S/c1-13-14(2)19(15(3)16-12-24(7,8)34-18(13)16)36(32,33)28-21(25)26-11-9-10-17(20(29)30)27-22(31)35-23(4,5)6/h17H,9-12H2,1-8H3,(H,27,31)(H,29,30)(H3,25,26,28)/t17-/m0/s1 |
| InChI Key | CVFXPOKENLGCID-KRWDZBQOSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352209 |
| MSDS | msds/88174_1_114873_08_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| N-Boc-cyclopropylamine | 132844-48-5 | 2A-9088096 |
| Ethyl(S)-1-Phenylethylcarbamate | 33290-12-9 | 2A-9088109 |
| EthylN-Cbz-morpholine-2-carboxylate | 1226776-83-5 | 2A-9088111 |
| 4,6-Dichloroisoxazolo[5,4-d]pyrimidine | 1197193-09-1 | 2A-9088136 |
| (R)-[(1-Phenylethyl)amino]aceticAcid | 78397-15-6 | 2A-9088137 |
| (3S,4R)-piperidine-3,4-diol | 39640-70-5 | 2A-9088177 |
| L-N-Boc-6-chlorotryptophan | 1217738-82-3 | 2A-9088179 |
| 3-Bromoimidazo[1,2-a]pyrazine | 57948-41-1 | 2A-9088180 |
| L-N-Boc-6-fluorotryptophan | 320581-69-9 | 2A-9088183 |
| (R)-2-phenylpiperidine | 58613-54-0 | 2A-9088186 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA