
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2967-72-8 |
| Catalog No. | 2A-9088107 |
| Chinese Name | 3-(2-氟苯氧基)丙酸 |
| Synonyms | MFCD01569309 |
| Molecular Formula | C9H9FO3 |
| Molecular Weight | 184.16400 |
| Density | 1.267g/cm3 |
| Boiling Point | 282.5ºC at 760mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| SMILES | O=C(O)CCOc1ccccc1F |
| InChI | InChI=1S/C9H9FO3/c10-7-3-1-2-4-8(7)13-6-5-9(11)12/h1-4H,5-6H2,(H,11,12)/p-1 |
| InChI Key | HTFQCXHHEIUZPM-UHFFFAOYSA-N |
| MSDS | msds/88107_1_2967_72_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 7-Acetamido-3,4-dihydro-2H-1,5-benzodioxepine | 33631-94-6 | 2A-9088100 |
| Dimethyl2-(Phenylamino)-2-butenedioate | 54494-74-5 | 2A-9088101 |
| Ethyl2-Acetyl-3-hydroxy-2-butenoate | 1830-94-0 | 2A-9088102 |
| Methyl3-Nitrophenylacetate | 10268-12-9 | 2A-9088103 |
| Methyl2-Methyl-4-(methylsulfonyl)benzoate | 875895-64-0 | 2A-9088105 |
| Methyl4-Methoxy-3-methylbenzoate | 70347-04-5 | 2A-9088114 |
| 7-BROMO-6-FLUORO-3,3-DIMETHYL-3,4-DIHYDROQUINOXALIN-2(1H)-ONE | 1188265-10-2 | 2A-9088115 |
| Methyl4-Fluoro-3-methylbenzoate | 180636-50-4 | 2A-9088116 |
| Methyl3-Methyl-4-(methylsulfonyl)benzoate | 1226776-89-1 | 2A-9088118 |
| Methyl3-(Chlorosulfonyl)propanoate | 15441-07-3 | 2A-0201310 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA