CAS Number98946-18-0
Synonymstert-Butyl 2,2,2-trichloroethanimidoate; tert-butyl 2,2,2-trichloroethanimidate; MFCD00237376; 2-Methyl-2-propanyl 2,2,2-trichloroethanimidate; Ethanimidic acid, 2,2,2-trichloro-, 1,1-dimethylethyl ester
Molecular FormulaCCl3C(=NH)OC(CH3)3
Molecular Weight218.51
Purity96%
Density1.3±0.1 g/cm3
Boiling Point65 °C/11 mmHg (lit.)
Melting Point21 °C (lit.)
AppearanceTransparent colorless to light yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 98946-18-0 |
| Catalog No. | 2A-9008790 |
| Chinese Name | 叔丁基三氯乙酰亚胺酯 |
| Synonyms | tert-Butyl 2,2,2-trichloroethanimidoate; tert-butyl 2,2,2-trichloroethanimidate; MFCD00237376; 2-Methyl-2-propanyl 2,2,2-trichloroethanimidate; Ethanimidic acid, 2,2,2-trichloro-, 1,1-dimethylethyl ester |
| Molecular Formula | CCl3C(=NH)OC(CH3)3 |
| Molecular Weight | 218.51 |
| Purity | 96 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 65 °C/11 mmHg (lit.) |
| Melting Point | 21 °C (lit.) |
| Appearance | Transparent colorless to light yellow liquid |
| Storage Condition | Store airtight in a cool, dry warehouse. Refrigera |
| Packaging | III |
| HTC | 2925290090 |
| UN(IATA) | UN 1993 |
| PubChem ID | 24862454 |
| MDL Number | MFCD00077410 |
| SMILES | CC(C)(C)OC(=N)C(Cl)(Cl)Cl |
| InChI | 1S/C6H10Cl3NO/c1-5(2,3)11-4(10)6(7,8)9/h10H,1-3H3 |
| InChI Key | CQXDYHPBXDZWBA-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1770049 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 3.2 |
| Risk Codes | R10;R36/37/38 |
| Safety Description | S16;S26;S37/39 |
| MSDS | msds/8790_1_98946_18_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations Classification: Class 3 Flammable Liquids. UN number: 1993 Proper shipping name: Flammable Liquid, not otherwise specified Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| tert-Butyl 2-bromoisobutylate | 23877-12-5 | 2A-9008779 |
| tert-Butyl 7-[3-(4-fluorophenyl)-1-isopropyl-2,3-dihydroindol-2-yl]-3,5-dihydroxyhept-6-enoate | 2A-108784 | 2A-9008784 |
| tert-Butyl 7-[3-(4-Fluorophenyl)-1-isopropyl-2,3-dihydroindol-2-yl]-5-hydroxy-3-oxohept-6-enoate | 2A-108785 | 2A-9008785 |
| tert-Butyl N-(4-bromophenyl)carbamate | 131818-17-2 | 2A-9008786 |
| tert-Butyl nitrite | 540-80-7 | 2A-9008787 |
| tert-Butylbenzene | 98-06-6 | 2A-9008792 |
| tert-Butylcarbazate | 870-46-2 | 2A-9008793 |
| tert-Octylisocyanide | 14542-93-9 | 2A-9008795 |
| Tetrabromoterephthalic acid | 5411-70-1 | 2A-9008805 |
| Tetrabutylammonium fluoride trihydrate | 87749-50-6 | 2A-9008806 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS