
CAS Number25343-70-8
SynonymsMFCD00041341; 2,6-diisopropylphenyl isothiocyanide; 1,3-Diisopropyl-2-isothiocyanatobenzene; 2,6-DIISOPROPYLPHENYL ISOTHIOCYANATE; 2,6-diisopropylphenylisothiocyanate; 2,5-DIHYDRO-A,2,4,5-TETRAMETHYL-2-THIAZOLEMETHANETHIOLO
Molecular FormulaC13H17N1S1
Molecular Weight219.35
Density1,01 g/cm3
Boiling Point140°C 5mm
AppearanceLiquid;Colorless to Light yellow to Light orange clear liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 25343-70-8 |
| Catalog No. | 2A-9087724 |
| Chinese Name | 1,3-二异丙基-2-异硫氰酸苯 |
| Synonyms | MFCD00041341; 2,6-diisopropylphenyl isothiocyanide; 1,3-Diisopropyl-2-isothiocyanatobenzene; 2,6-DIISOPROPYLPHENYL ISOTHIOCYANATE; 2,6-diisopropylphenylisothiocyanate; 2,5-DIHYDRO-A,2,4,5-TETRAMETHYL-2-THIAZOLEMETHANETHIOLO |
| Molecular Formula | C13H17N1S1 |
| Molecular Weight | 219.35 |
| Density | 1,01 g/cm3 |
| Boiling Point | 140°C 5mm |
| Appearance | Liquid;Colorless to Light yellow to Light orange clear liquid |
| Storage Condition | Dispose under dry protective gas, Keep receptacles |
| Packaging | II |
| HTC | 2930909090 |
| MDL Number | MFCD00041341 |
| SMILES | CC(C)c1cccc(C(C)C)c1N=C=S |
| InChI | InChI=1S/C13H17NS/c1-9(2)11-6-5-7-12(10(3)4)13(11)14-8-15/h5-7,9-10H,1-4H3 |
| InChI Key | HZGOUCYIYIFQHX-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/87724_1_25343_70_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2930909090. other organo-sulfur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| 4-Butylphenylisothiocyanate | 23165-44-8 | 2A-9087699 |
| 4-tert-Butylphenylisothiocyanate | 19241-24-8 | 2A-9087705 |
| 2-Chlorobenzoylisothiocyanate | 5067-90-3 | 2A-9087713 |
| 3-Chlorobenzoylisothiocyanate | 66090-36-6 | 2A-9087716 |
| 4-Chlorobenzoylisothiocyanate | 16794-67-5 | 2A-9087720 |
| 7-Benzyl-7-azabicyclo[2.2.1]heptane-1-methanamine | 1193090-83-3 | 2A-9087730 |
| (R)-4-Morpholino-1-(phenylthio)-2-butylamine | 870812-95-6 | 2A-9087737 |
| (R)-1-(2,4-difluorophenyl)ethanamine | 791098-84-5 | 2A-9087748 |
| N-Cbz-9-azabicyclo[3.3.1]nonan-3-one | 146747-65-1 | 2A-9087758 |
| 3-(N-Boc-Amino)-5-hydroxybenzoicAcid | 232595-59-4 | 2A-9087772 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA