
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 116753-51-6 |
| Catalog No. | 2A-9087688 |
| Chinese Name | 3-(3-硝基苯氧基)-1-丙胺 |
| Synonyms | 3-(3-nitrophenoxy)propan-1-amine; 3-(3-Nitrophenoxy)-1-propanamine |
| Molecular Formula | C9H12O3N2 |
| Molecular Weight | 196.21 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 354.1±22.0 °C at 760 mmHg |
| HTC | 2922299090 |
| MDL Number | MFCD12818946 |
| SMILES | NCCCOc1cccc([N+](=O)[O-])c1 |
| InChI Key | QMRSDYBQUDEVCQ-UHFFFAOYSA-N |
| MSDS | msds/87688_1_116753_51_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Methyl-6-nitroanisole | 18102-29-9 | 2A-9087678 |
| Ethyl4,6-Dichloro-2-methylnicotinate | 686279-09-4 | 2A-9087679 |
| 3-(4-Nitrophenoxy)propylamine | 100841-04-1 | 2A-9087680 |
| 2-Methyl-4-nitroanisole | 50741-92-9 | 2A-9087682 |
| 3-ChlorophenethylBromide | 16799-05-6 | 2A-9087685 |
| 3-(2-Nitrophenoxy)propylamine | 103546-10-7 | 2A-9087691 |
| 1-tert-Butyl-3-nitrobenzene | 23132-52-7 | 2A-9087694 |
| 2-Fluoro-4-(methylsulfonyl)benzoicAcid | 142994-04-5 | 2A-9087700 |
| 4-(Methylsulfonyl)benzylAlcohol | 22821-77-8 | 2A-9087701 |
| 5-(Methylsulfonyl)nicotinicAcid | 893723-59-6 | 2A-9087702 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA