
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 939-83-3 |
| Catalog No. | 2A-9087675 |
| Chinese Name | 2-甲基-5-硝基苯腈 |
| Synonyms | 5-Nitro-ortho-tolunitrile; 2-Methyl-5-nitrobenzonitrile; MFCD00017040 |
| Molecular Formula | C8H5O2N2F1 |
| Molecular Weight | 180.14 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 291.5±28.0 °C at 760 mmHg |
| Melting Point | 103.5-107.5 °C(lit.) |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| Packaging | III |
| HTC | 2926909090 |
| MDL Number | MFCD19441322 |
| SMILES | Cc1ccc([N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C8H6N2O2/c1-6-2-3-8(10(11)12)4-7(6)5-9/h2-4H,1H3 |
| InChI Key | XOSDYLFXPMFRGF-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/87675_1_939_83_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(tert-Butyldimethylsiloxy)pent-2-en-4-one | 69404-97-3 | 2A-9087669 |
| 1-Butylethylether | 628-81-9 | 2A-9087670 |
| 3-(2-Methylphenoxy)propylamine | 50911-61-0 | 2A-9087671 |
| 3-Chloro-5-nitrobenzonitrile | 34662-30-1 | 2A-9087672 |
| 3-[4-(Methylthio)phenoxy]propylamine | 1226776-90-4 | 2A-9087674 |
| 4,6-Dichloro-2-methylnicotinicAcid | 693286-31-6 | 2A-9087676 |
| 2-Methyl-6-nitroanisole | 18102-29-9 | 2A-9087678 |
| Ethyl4,6-Dichloro-2-methylnicotinate | 686279-09-4 | 2A-9087679 |
| 3-(4-Nitrophenoxy)propylamine | 100841-04-1 | 2A-9087680 |
| 2-Methyl-4-nitroanisole | 50741-92-9 | 2A-9087682 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA