
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 50911-59-6 |
| Catalog No. | 2A-9087641 |
| Chinese Name | 3-(2-氯苯氧基)-1-丙胺 |
| Synonyms | 3-(2-Chlorophenoxy)propylamine |
| Molecular Formula | C9H12ClNO |
| Molecular Weight | 214.65 |
| Density | 1.145g/cm3 |
| Boiling Point | 287.9ºC at 760 mmHg |
| Appearance | solid |
| HTC | 2922299090 |
| PubChem ID | 329782068 |
| MDL Number | MFCD01695660 |
| SMILES | CC(C)(Oc1cccc(Cl)c1)C(O)=O |
| InChI | 1S/C10H11ClO3/c1-10(2,9(12)13)14-8-5-3-4-7(11)6-8/h3-6H,1-2H3,(H,12,13) |
| InChI Key | PZBIVIXQLIVFHJ-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| MSDS | msds/87641_1_50911_59_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl5-HydroxynicotinateHydrochloride | 89937-78-0 | 2A-9087636 |
| Dimethyl2-(2-Fluoro-4-nitrophenyl)malonate | 188975-47-5 | 2A-9087637 |
| 1-Bromo-2,4,6-trichlorobenzene | 19393-96-5 | 2A-9087638 |
| LithiumIodideHydrate | 85017-80-7 | 2A-9087639 |
| 5-Bromo-2-methyl-3-nitrobenzoicAcid | 107650-20-4 | 2A-9087640 |
| Methyl2-(Chlorosulfonyl)acetate | 56146-83-9 | 2A-9087643 |
| 2,2-Diphenylpropane | 778-22-3 | 2A-9087645 |
| (2-Chlorophenyl)diphenylmethylchloride | 42074-68-0 | 2A-9087648 |
| MethylAcetimidateHydrochloride | 14777-27-6 | 2A-9087650 |
| tert-Butoxychlorodiphenylsilane | 17922-24-6 | 2A-9087651 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA