
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 50911-60-9 |
| Catalog No. | 2A-9087631 |
| Chinese Name | 3-(4-氯苯氧基)丙胺 |
| Synonyms | MFCD06213576 |
| Molecular Formula | C15H11ClO3 |
| Molecular Weight | 185.65100 |
| Density | 1.145g/cm3 |
| Boiling Point | 290.4ºC at 760 mmHg |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2922299090 |
| MDL Number | MFCD06496624 |
| SMILES | O=C(O)/C=C/C(C=C1)=CC=C1OC(C=C2)=CC=C2Cl |
| InChI | 1S/C15H11ClO3/c16-12-4-8-14(9-5-12)19-13-6-1-11(2-7-13)3-10-15(17)18/h1-10H,(H,17,18)/b10-3+ |
| InChI Key | SUNFGEUEMIMDMJ-XCVCLJGOSA-N |
| UNSPSC | 12352106 |
| MSDS | msds/87631_1_50911_60_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(3-Methoxyphenoxy)propylamine | 6451-26-9 | 2A-9087625 |
| N-Methyl-4-chlorobenzylamineHydrochloride | 65542-24-7 | 2A-9087626 |
| 4-Bromophenylisocyanide | 33554-73-3 | 2A-9087627 |
| N-Methyl-3-bromobenzylamineHydrochloride | 90389-51-8 | 2A-9087628 |
| 3-(2-Methoxyphenoxy)propylamine | 3245-88-3 | 2A-9087629 |
| 1-Bromo-11-phenylundecane | 101025-08-5 | 2A-9087633 |
| 3-(3-Chlorophenoxy)propylamine | 116753-50-5 | 2A-9087634 |
| Methyl5-HydroxynicotinateHydrochloride | 89937-78-0 | 2A-9087636 |
| Dimethyl2-(2-Fluoro-4-nitrophenyl)malonate | 188975-47-5 | 2A-9087637 |
| 1-Bromo-2,4,6-trichlorobenzene | 19393-96-5 | 2A-9087638 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA