
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6487-99-6 |
| Catalog No. | 2A-9087584 |
| Chinese Name | 2-(3-甲基苯氧基)乙胺 |
| Synonyms | 2-(3-methylphenoxy)ethanamine; 2-(3-Methylphenoxy)ethanamine hydrochloride (1:1); Ethanamine, 2-(3-methylphenoxy)-, hydrochloride (1:1) |
| Molecular Formula | C9H13O1N1 |
| Molecular Weight | 151.21 |
| Density | 1.008g/cm3 |
| Boiling Point | 256.3ºC at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2922299090 |
| MDL Number | MFCD02856329 |
| SMILES | Cc1cccc(OCCN)c1 |
| InChI | InChI=1S/C9H13NO/c1-8-3-2-4-9(7-8)11-6-5-10/h2-4,7H,5-6,10H2,1H3/p+1 |
| InChI Key | IGGVZLIHUYNMNQ-UHFFFAOYSA-N |
| MSDS | msds/87584_1_6487_99_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(2-Aminoethoxy)benzonitrile | 120351-94-2 | 2A-9087571 |
| (-)-MenthyloxyaceticAcid | 40248-63-3 | 2A-9087572 |
| 2-(2-Aminoethoxy)benzonitrile | 57276-65-0 | 2A-9087575 |
| N-(2,5-Dimethyl-4-nitrophenyl)acetamide | 6954-69-4 | 2A-9087577 |
| 2-(4-Methylphenoxy)ethylamine | 26583-58-4 | 2A-9087581 |
| 2-(2-Methylphenoxy)ethylamine | 26583-60-8 | 2A-9087590 |
| 2-(2-Hydroxyethylamino)-4'-nitroacetanilide | 925920-70-3 | 2A-9087591 |
| Benzoylnitromethane | 614-21-1 | 2A-9087592 |
| 5-Fluoro-2-pyrrolidinobenzoicAcid | 1096304-38-9 | 2A-9087593 |
| 2-[2-(Methylthio)phenoxy]ethylamine | 72955-86-3 | 2A-9087594 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA