
CAS Number64152-09-6
Synonyms1,3-Benzenedicarboxylic acid, 4-nitro-, 3-methyl ester; 3-(Methoxycarbonyl)-4-nitrobenzoic acid; 3-methoxycarbonyl-4-nitrobenzoic acid
Molecular FormulaC9H7NO6
Molecular Weight209.99
Density1.5±0.1 g/cm3
Boiling Point415.9±35.0 °C at 760 mmHg
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 64152-09-6 |
| Catalog No. | 2A-9087565 |
| Chinese Name | 4-硝基-3-甲氧基羰基苯甲酸 |
| Synonyms | 1,3-Benzenedicarboxylic acid, 4-nitro-, 3-methyl ester; 3-(Methoxycarbonyl)-4-nitrobenzoic acid; 3-methoxycarbonyl-4-nitrobenzoic acid |
| Molecular Formula | C9H7NO6 |
| Molecular Weight | 209.99 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 415.9±35.0 °C at 760 mmHg |
| Appearance | solid |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| PubChem ID | 329774441 |
| MDL Number | MFCD07366483 |
| SMILES | OB(C1=CC=C(C(OC)=O)C(OC)=C1)O |
| InChI | 1S/C9H11BO5/c1-14-8-5-6(10(12)13)3-4-7(8)9(11)15-2/h3-5,12-13H,1-2H3 |
| InChI Key | YCXPWNGIPLGCOJ-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| MSDS | msds/87565_1_64152_09_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(3-Methoxyphenoxy)ethylamine | 6487-86-1 | 2A-9087555 |
| 2-(4-Chlorophenoxy)ethylamine | 28769-06-4 | 2A-9087557 |
| 2-(3-Chlorophenoxy)ethylamine | 6488-00-2 | 2A-9087560 |
| 2-(2-Chlorophenoxy)ethylamine | 26378-53-0 | 2A-9087562 |
| Ethyl2-Cyanobenzoate | 6525-45-7 | 2A-9087564 |
| 4-(2-Aminoethoxy)benzonitrile | 67333-09-9 | 2A-9087567 |
| 5-(Methoxycarbonyl)-2-nitrobenzoicAcid | 76143-33-4 | 2A-9087568 |
| Dimethyl2-(2-Pyrimidyl)malonate | 93271-75-1 | 2A-9087570 |
| 3-(2-Aminoethoxy)benzonitrile | 120351-94-2 | 2A-9087571 |
| (-)-MenthyloxyaceticAcid | 40248-63-3 | 2A-9087572 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA