
CAS Number139768-71-1
Synonyms4-benzyloxyisothiocyanate; MFCD00041095; 4-phenylmethoxyphenylisothiocyanate; 4-Benzyloxy-phenylisothiocyanat; 4-BENZYLOXYPHENYL ISOTHIOCYANATE
Molecular FormulaC14H11NOS
Molecular Weight241.30800
Density1.09 g/cm3
Boiling Point392.9ºC at 760 mmHg
Melting Point62 °C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 139768-71-1 |
| Catalog No. | 2A-9087544 |
| Chinese Name | 4-苄氧苯基硫杂异氰酸酯 |
| Synonyms | 4-benzyloxyisothiocyanate; MFCD00041095; 4-phenylmethoxyphenylisothiocyanate; 4-Benzyloxy-phenylisothiocyanat; 4-BENZYLOXYPHENYL ISOTHIOCYANATE |
| Molecular Formula | C14H11NOS |
| Molecular Weight | 241.30800 |
| Density | 1.09 g/cm3 |
| Boiling Point | 392.9ºC at 760 mmHg |
| Melting Point | 62 °C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | III |
| HTC | 2930909090 |
| SMILES | S=C=Nc1ccc(OCc2ccccc2)cc1 |
| InChI Key | OQXRBXAFSXVCCO-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2930909090. other organo-sulfur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| N-Methyl-4-(4-morpholinyl)benzylamine | 179328-22-4 | 2A-9087368 |
| Morpholino(2-piperidinyl)methanoneHydrochloride | 690634-79-8 | 2A-9087397 |
| (R)-3-(N-Boc-N-methylamino)pyrrolidine | 392338-15-7 | 2A-9087399 |
| 4-(N-Boc-N-methylamino)cyclohexanone | 400899-84-5 | 2A-9087487 |
| Ethyl3-(N-Cbz-piperidin-4-yl)-3-oxopropanoate | 167414-75-7 | 2A-9087495 |
| 2-Acetylquinoxaline | 25594-62-1 | 2A-9087551 |
| 2-Ethyl-6-methylphenylisocyanate | 75746-71-3 | 2A-9087602 |
| 2-Bromo-4-methylphenylisothiocyanate | 19241-39-5 | 2A-9087604 |
| 4-Bromo-3-methylphenylisothiocyanate | 71672-88-3 | 2A-9087606 |
| EthylN-Boc-3-oxopiperidine-2-carboxylate | 1245782-62-0 | 2A-9087609 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA