
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7650-84-2 |
| Catalog No. | 2A-9087490 |
| Chinese Name | 二苯基丙基磷 |
| Synonyms | EINECS 231-607-0; DIPHENYL-N-PROPYLPHOSPHINE; Diphenyl(propyl)phosphine; MFCD00015216 |
| Molecular Formula | C15H17P1 |
| Molecular Weight | 228.27 |
| Density | 1,008 g/cm3 |
| Boiling Point | 304.1±0.0 °C at 760 mmHg |
| Appearance | Liquid;Colorless to Almost colorless clear liquid |
| Storage Condition | Store under inert gas; avoid air |
| HTC | 2931900090 |
| MDL Number | MFCD00015216 |
| SMILES | CCCP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H17P/c1-2-13-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3 |
| InChI Key | AAXGWYDSLJUQLN-UHFFFAOYSA-N |
| MSDS | msds/87490_1_7650_84_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dimethyl5-Fluoroisophthalate | 17449-48-8 | 2A-9087483 |
| Trimethylacetamide | 754-10-9 | 2A-9087484 |
| N-(4-Methoxy-2-methyl-5-nitrophenyl)acetamide | 196194-97-5 | 2A-9087485 |
| 2-(Cyclopentyloxy)ethylamineHydrochloride | 1181457-94-2 | 2A-9087486 |
| 2-Fluoro-4-nitrophenylaceticAcid | 315228-19-4 | 2A-9087489 |
| 2-(Cyclohexyloxy)ethylamineHydrochloride | 1193387-70-0 | 2A-9087491 |
| Ethyl3-(2-Pyrazinyl)-3-oxopropanoate | 62124-77-0 | 2A-9087492 |
| N-Benzyl-3-bromo-4-methylbenzenesulfonamide | 850429-67-3 | 2A-9087496 |
| Methyl3-(5-Ethyl-1,2,4-oxadiazol-3-yl)benzoate | 1166756-75-7 | 2A-9087497 |
| 2,3,4,5,6-Pentabromoethylbenzene | 85-22-3 | 2A-9087498 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA