
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6450-57-3 |
| Catalog No. | 2A-9087461 |
| Chinese Name | 1-(2-均三甲苯)-1,3-丁烷二酮 |
| Synonyms | 1-(2,4,6-trimethylphenyl)butane-1,3-dione |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.26500 |
| Density | 1.021g/cm3 |
| Boiling Point | 172ºC / 22mmHg |
| Melting Point | 45ºC |
| Appearance | Solid;White or Colorless to Yellow powder to lump to clear liquid |
| Storage Condition | 2~8°C |
| HTC | 2914399090 |
| SMILES | CC(=O)CC(=O)c1c(C)cc(C)cc1C |
| InChI Key | MBZZDUHWYNESIY-UHFFFAOYSA-N |
| MSDS | msds/87461_1_6450_57_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 96.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Chloro-4-ethylbenzene | 622-98-0 | 2A-9087455 |
| 4-Chloro-2-isothiocyanato-1-methoxy-benzene | 63429-99-2 | 2A-9087456 |
| Isopropyldiphenylphosphine | 6372-40-3 | 2A-9087458 |
| 4-Amino-3-methoxyphenol | 61638-01-5 | 2A-9087459 |
| Diethyl(3-methylbenzyl)phosphonate | 63909-50-2 | 2A-9087460 |
| Sodium4-(2-bromoethyl)benzenesulfonate | 65036-65-9 | 2A-9087463 |
| 3-Amino-N,N-dimethylbenzenesulfonamide | 6274-18-6 | 2A-9087464 |
| 2-Bromo-1,3-diethylbenzene | 65232-57-7 | 2A-9087465 |
| 2-Nitrocumene | 6526-72-3 | 2A-9087466 |
| Methyl2-Fluoro-4-nitrophenylacetate | 337529-74-5 | 2A-9087467 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA