
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 56207-36-4 |
| Catalog No. | 2A-9087446 |
| Chinese Name | 2'-甲基-3'-硝基乙酰苯胺 |
| Synonyms | N-(2-methyl-3-nitrophenyl)acetamide |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 229.62 |
| Density | 1.289 g/cm3 |
| Boiling Point | 353.4ºC at 760 mmHg |
| Melting Point | 162ºC |
| Appearance | Slightly light yellow -yellow green crystal -powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2924299090 |
| SMILES | O=C(OC)C1=CC=CC(=C1CCl)N(=O)=O |
| InChI | InChI=1S/C9H8ClNO4/c1-15-9(12)6-3-2-4-8(11(13)14)7(6)5-10/h2-4H,5H2,1H3 |
| InChI Key | OGMCDJBYZAKJTP-UHFFFAOYSA-N |
| UNSPSC | 41116107 |
| MSDS | msds/87446_1_56207_36_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(2-Bromoethyl)benzenesulfonicacid | 54322-31-5 | 2A-9087441 |
| Ethyl2-Nitrophenylacetate | 31912-02-4 | 2A-9087442 |
| N-Methyl-3,4-dimethylbenzylamine | 165741-71-9 | 2A-9087443 |
| 2,3,4,5-Tetramethyliodobenzene | 54509-71-6 | 2A-9087444 |
| N-Ethyl-3,4-dimethylbenzylamine | 39180-83-1 | 2A-9087445 |
| Benzinidicacidmethylesterhydrochloride | 5873-90-5 | 2A-9087447 |
| 3,3'-Dimethylazobenzene | 588-04-5 | 2A-9087449 |
| 2-Methoxy-4-methylbenzenesulfonamide | 59554-39-1 | 2A-9087450 |
| 3-(4'-Methoxyphenyl)propylchloride | 59623-12-0 | 2A-9087452 |
| Hexaethylbenzene | 604-88-6 | 2A-9087453 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA