
CAS Number3853-91-6
SynonymsIodopentamethylbenzene; EINECS 223-360-2; PENTAMETHYLIODOBENZENE; Jod-pentamethyl-benzol; iodo-pentamethyl-benzene; 2,3,4,5,6-pentamethyliodobenzene; 1-Iodo-2,3,4,5,6-pentamethylbenzene; MFCD00015446
Molecular FormulaC11H15I1
Molecular Weight274.14
Density1.421g/cm3
Boiling Point297.9ºC at 760mmHg
Melting Point135-137°C
AppearanceLight yellow to light yellow crystal-powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3853-91-6 |
| Catalog No. | 2A-9087415 |
| Chinese Name | 五甲基碘苯 |
| Synonyms | Iodopentamethylbenzene; EINECS 223-360-2; PENTAMETHYLIODOBENZENE; Jod-pentamethyl-benzol; iodo-pentamethyl-benzene; 2,3,4,5,6-pentamethyliodobenzene; 1-Iodo-2,3,4,5,6-pentamethylbenzene; MFCD00015446 |
| Molecular Formula | C11H15I1 |
| Molecular Weight | 274.14 |
| Density | 1.421g/cm3 |
| Boiling Point | 297.9ºC at 760mmHg |
| Melting Point | 135-137°C |
| Appearance | Light yellow to light yellow crystal-powder |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| HTC | 2903999090 |
| MDL Number | MFCD00015446 |
| SMILES | Cc1c(C)c(C)c(I)c(C)c1C |
| InChI | InChI=1S/C11H15I/c1-6-7(2)9(4)11(12)10(5)8(6)3/h1-5H3 |
| InChI Key | UXHBVYKGPRUHKM-UHFFFAOYSA-N |
| MSDS | msds/87415_1_3853_91_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(3,5-Dimethyl-1H-pyrazol-1-yl)aniline | 52708-32-4 | 2A-9087398 |
| 1,4-Diiodo-2,3,5,6-tetramethylbenzene | 3268-21-1 | 2A-9087400 |
| 2-Piperidinobenzylamine | 72752-54-6 | 2A-9087409 |
| 3-Chloropropyl-n-octylsulfoxide | 3569-57-1 | 2A-9087411 |
| 2,2-Dichlorocyclopropylphenylsulfone | 38435-04-0 | 2A-9087414 |
| 1,4-Di-N-Propoxybenzene | 3898-41-7 | 2A-9087417 |
| N-MethylcyclopropanamineHydrochloride | 67376-94-7 | 2A-9087419 |
| N-Ethyl-N-(3-pyridylmethyl)amine | 3000-75-7 | 2A-9087421 |
| 1,4-Dibromo-2,5-diethylbenzene | 40787-48-2 | 2A-9087422 |
| N-Ethyl-N-(2-pyridylmethyl)amine | 51639-58-8 | 2A-9087423 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA