![2-[2-(Dimethylamino)ethoxy]benzylamine structure, CAS 91215-97-3](/structures/100000/87378_1_91215_97_3.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 91215-97-3 |
| Catalog No. | 2A-9087378 |
| Chinese Name | 2-(2-二甲胺)乙氧基苄胺 |
| Synonyms | 2-[2-(aminomethyl)phenoxy]-N,N-dimethylethanamine |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 |
| Density | 1.021g/cm3 |
| Boiling Point | 89-91 |
| Storage Condition | 2-8°C, sealed, dry |
| HTC | 2922199090 |
| MDL Number | C11H18N2O |
| SMILES | CN(C)CCOc1ccccc1CN |
| InChI | InChI=1S/C11H18N2O/c1-13(2)7-8-14-11-6-4-3-5-10(11)9-12/h3-6H,7-9,12H2,1-2H3 |
| InChI Key | NOZRJUDRDVKQDW-UHFFFAOYSA-N |
| MSDS | msds/87378_1_91215_97_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(Piperidin-1-yl)benzylamine | 175696-71-6 | 2A-9087372 |
| 1,2-Epoxy-7-octene | 19600-63-6 | 2A-9087374 |
| Vanadyl sulphate | 12439-96-2 | 2A-9087375 |
| 3-HYDROXY-3-METHYLGLUTARIC ANHYDRIDE | 34695-32-4 | 2A-9087376 |
| N-Methyl-2-phenoxybenzylamine | 361394-74-3 | 2A-9087377 |
| 2-(Tetrahydro-2H-pyran-4-yloxy)aniline | 898289-35-5 | 2A-9087379 |
| 1,2-Epoxyeicosane | 19780-16-6 | 2A-9087381 |
| 5-Chloro-2-methoxy-4-methylbenzenesulfonamide | 199590-75-5 | 2A-9087382 |
| 4-Chloro-2,5-dimethylbenzenesulfonamide | 219689-73-3 | 2A-9087385 |
| 1,3-Bis(Tosyloxy)-2,2-dimethylpropane | 22308-12-9 | 2A-9087386 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA